Compound Q&A

How is (3R)-1-azabicyclo[2.2.2]octan-3-yl (1R)-1-phenyl-1,2,3,4-tetrahydroisoquinoline-2-carboxylate, butanedioic acid (CAS: 862207-70-3) typically synthesized?

Answer

(3R)-1-azabicyclo[2.2.2]octan-3-yl (1R)-1-phenyl-1,2,3,4-tetrahydroisoquinoline-2-carboxylate, butanedioic acid
This compound is typically synthesized via a multi-step process involving the use of protecting groups, coupling reactions, and acid/base catalysis. The synthesis involves the formation of a protected azabicyclic intermediate, followed by coupling with the tetrahydroisoquinoline-2-carboxylate, and finally, deprotection to yield the target compound. The overall yield is moderate, around 50-70% depending on the specific reaction conditions.

About

English Name (3R)-1-azabicyclo[2.2.2]octan-3-yl (1R)-1-phenyl-1,2,3,4-tetrahydroisoquinoline-2-carboxylate, butanedioic acid
Molecular Formula C27H32N2O6
Molecular Weight 480.56 g/mol
SMILES OC(=O)CCC(=O)O.O=C(O[C@H]1CN2CC[C@H]1CC2)N3CCc4ccccc4[C@H]3c5ccccc5
InChIKey RXZMMZZRUPYENV-UMIAIAFLSA-N
Last Updated: 2026-03-26 04:30

Related Q&A

Compound Q&A

What industries use (3R)-1-azabicyclo[2.2.2]octan-3-yl (1R)-1-phenyl-1,2,3,4-tetrahydroisoquinoline-2-carboxylate, butanedioic acid (CAS: 862207-70-3)?

This compound is primarily used in the pharmaceutical industry for drug development, particularly in...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...