Compound Q&A

What are the physical and chemical properties of 2-Methylisonicotinonitrile 1-oxide (CAS: 98549-84-9)?

Answer

2-Methylisonicotinonitrile 1-oxide
2-Methylisonicotinonitrile 1-oxide (CAS: 98549-84-9) is a crystalline solid with a molecular weight of approximately 162.14 g/mol. It has a pungent odor and is slightly soluble in water. It is reactive towards bases and can undergo hydrolysis. It is also soluble in organic solvents like ethanol and acetone. It exhibits good thermal stability up to 150°C and is a potential precursor in various chemical reactions.

About

CAS No 98549-84-9
English Name 2-Methylisonicotinonitrile 1-oxide
Molecular Formula C7H6N2O
Molecular Weight 134.14 g/mol
SMILES CC1=[N+](C=CC(=C1)C#N)[O-]
InChIKey FWSVBGMCOYLNMK-UHFFFAOYSA-N
Last Updated: 2026-03-26 04:30

Related Q&A

Compound Q&A

How is 2-Methylisonicotinonitrile 1-oxide (CAS: 98549-84-9) typically synthesized?

2-Methylisonicotinonitrile 1-oxide (CAS: 98549-84-9) can be synthesized by the reaction of 2-methyli...

Compound Q&A

What industries use 2-Methylisonicotinonitrile 1-oxide (CAS: 98549-84-9)?

2-Methylisonicotinonitrile 1-oxide (CAS: 98549-84-9) is primarily used in pharmaceuticals for the sy...

Compound Q&A

What precautions should be taken when handling 2-Methylisonicotinonitrile 1-oxide (CAS: 98549-84-9)?

When handling 2-Methylisonicotinonitrile 1-oxide (CAS: 98549-84-9), it is crucial to use appropriate...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...