Compound Q&A

What industries use Ethyl 6-phenylimidazo[2,1-b][1,3]thiazole-3-carboxylate (CAS: 752244-05-6)?

Answer

Ethyl 6-phenylimidazo[2,1-b][1,3]thiazole-3-carboxylate
Ethyl 6-phenylimidazo[2,1-b][1,3]thiazole-3-carboxylate is primarily used in the pharmaceutical industry due to its potential as a precursor for drug development. It also has applications in the polymer industry for its catalytic and stabilizing properties. Additionally, it is explored in the sensor and semiconductor industries for its unique chemical and physical properties.

About

English Name Ethyl 6-phenylimidazo[2,1-b][1,3]thiazole-3-carboxylate
Molecular Formula C14H12N2O2S
Molecular Weight 272.329 g/mol
SMILES CCOC(=O)C1=CSC2=NC(=CN12)C3=CC=CC=C3
InChIKey AKUAOHJSADUKFP-UHFFFAOYSA-N
Last Updated: 2026-03-25 23:49

Related Q&A

Compound Q&A

What are the physical and chemical properties of Ethyl 6-phenylimidazo[2,1-b][1,3]thiazole-3-carboxylate (CAS: 752244-05-6)?

Ethyl 6-phenylimidazo[2,1-b][1,3]thiazole-3-carboxylate has a crystalline form with a molecular weig...

Compound Q&A

How is Ethyl 6-phenylimidazo[2,1-b][1,3]thiazole-3-carboxylate (CAS: 752244-05-6) typically synthesized?

Ethyl 6-phenylimidazo[2,1-b][1,3]thiazole-3-carboxylate is typically synthesized through the amidati...

Compound Q&A

What precautions should be taken when handling Ethyl 6-phenylimidazo[2,1-b][1,3]thiazole-3-carboxylate (CAS: 752244-05-6)?

When handling Ethyl 6-phenylimidazo[2,1-b][1,3]thiazole-3-carboxylate, it is important to wear appro...

Compound Q&A

What is Ethyl 3-cyclohexylpropanoate (CAS: 10094-36-7)?

Ethyl 3-cyclohexylpropanoate is a clear, colorless to light yellow liquid with a...

10094-36-7Ethyl 3-cyclohexylpr...
Compound Q&A

How should waste containing 2-(Hydroxymethyl)-5-(methoxycarbonyl)-6-methyl-4-(2-nitrophenyl)nicotinic acid (CAS: 34783-31-8) be handled?

Waste containing 2-(Hydroxymethyl)-5-(methoxycarbonyl)-6-methyl-4-(2-nitrophenyl...

34783-31-82-(Hydroxymethyl)-5-...
Compound Q&A

How should waste containing 2,4,6-Tris(pentafluoroethyl)-1,3,5-triazine (CAS: 858-46-8) be handled?

Waste containing 2,4,6-Tris(pentafluoroethyl)-1,3,5-triazine (CAS: 858-46-8) sho...

858-46-82,4,6-Tris(pentafluo...
Compound Q&A

What precautions should be taken when handling Chloroac-nle-oh (CAS: 56787-36-1)?

When handling Chloroac-nle-oh (CAS: 56787-36-1), it is essential to wear appropr...

56787-36-1Chloroac-nle-oh