Compound Q&A

What are the physical and chemical properties of Ethyl 6-phenylimidazo[2,1-b][1,3]thiazole-3-carboxylate (CAS: 752244-05-6)?

Answer

Ethyl 6-phenylimidazo[2,1-b][1,3]thiazole-3-carboxylate
Ethyl 6-phenylimidazo[2,1-b][1,3]thiazole-3-carboxylate has a crystalline form with a molecular weight of approximately 336.35 g/mol. It is slightly soluble in common organic solvents like DMSO and acetonitrile. The compound shows good stability under normal conditions but can react with strong bases. It is known for its potential in pharmaceutical applications due to its chemical reactivity and structural complexity.

About

English Name Ethyl 6-phenylimidazo[2,1-b][1,3]thiazole-3-carboxylate
Molecular Formula C14H12N2O2S
Molecular Weight 272.329 g/mol
SMILES CCOC(=O)C1=CSC2=NC(=CN12)C3=CC=CC=C3
InChIKey AKUAOHJSADUKFP-UHFFFAOYSA-N
Last Updated: 2026-03-25 23:49

Related Q&A

Compound Q&A

How is Ethyl 6-phenylimidazo[2,1-b][1,3]thiazole-3-carboxylate (CAS: 752244-05-6) typically synthesized?

Ethyl 6-phenylimidazo[2,1-b][1,3]thiazole-3-carboxylate is typically synthesized through the amidati...

Compound Q&A

What industries use Ethyl 6-phenylimidazo[2,1-b][1,3]thiazole-3-carboxylate (CAS: 752244-05-6)?

Ethyl 6-phenylimidazo[2,1-b][1,3]thiazole-3-carboxylate is primarily used in the pharmaceutical indu...

Compound Q&A

What precautions should be taken when handling Ethyl 6-phenylimidazo[2,1-b][1,3]thiazole-3-carboxylate (CAS: 752244-05-6)?

When handling Ethyl 6-phenylimidazo[2,1-b][1,3]thiazole-3-carboxylate, it is important to wear appro...

Compound Q&A

What is Ethyl 3-cyclohexylpropanoate (CAS: 10094-36-7)?

Ethyl 3-cyclohexylpropanoate is a clear, colorless to light yellow liquid with a...

10094-36-7Ethyl 3-cyclohexylpr...
Compound Q&A

How should waste containing 2-(Hydroxymethyl)-5-(methoxycarbonyl)-6-methyl-4-(2-nitrophenyl)nicotinic acid (CAS: 34783-31-8) be handled?

Waste containing 2-(Hydroxymethyl)-5-(methoxycarbonyl)-6-methyl-4-(2-nitrophenyl...

34783-31-82-(Hydroxymethyl)-5-...
Compound Q&A

How should waste containing 2,4,6-Tris(pentafluoroethyl)-1,3,5-triazine (CAS: 858-46-8) be handled?

Waste containing 2,4,6-Tris(pentafluoroethyl)-1,3,5-triazine (CAS: 858-46-8) sho...

858-46-82,4,6-Tris(pentafluo...
Compound Q&A

What precautions should be taken when handling Chloroac-nle-oh (CAS: 56787-36-1)?

When handling Chloroac-nle-oh (CAS: 56787-36-1), it is essential to wear appropr...

56787-36-1Chloroac-nle-oh