Compound Q&A

What are the physical and chemical properties of N-Acetyl 6-Chlorotryptophan (CAS: 50517-10-7)?

Answer

N-Acetyl 6-chlorotryptophan
N-Acetyl 6-Chlorotryptophan (CAS: 50517-10-7) is a white crystalline solid. Its molecular weight is approximately 274.7 g/mol. It is slightly soluble in water and ethanol. Chemically, it is highly reactive towards nucleophiles and can undergo substitution reactions. This compound is used in various synthetic pathways and research applications.

About

CAS No 50517-10-7
English Name N-Acetyl 6-chlorotryptophan
Molecular Formula C13H13ClN2O3
Molecular Weight 280.71 g/mol
SMILES CC(=O)NC(CC1=CNC2=C1C=CC(=C2)Cl)C(=O)O
InChIKey LCLMWFCLWYOLIO-UHFFFAOYSA-N
Last Updated: 2026-03-25 23:49

Related Q&A

Compound Q&A

How is N-Acetyl 6-Chlorotryptophan (CAS: 50517-10-7) typically synthesized?

N-Acetyl 6-Chlorotryptophan (CAS: 50517-10-7) is typically synthesized via the acetylation of 6-chlo...

Compound Q&A

What industries use N-Acetyl 6-Chlorotryptophan (CAS: 50517-10-7)?

N-Acetyl 6-Chlorotryptophan (CAS: 50517-10-7) is primarily used in the pharmaceutical industry for t...

Compound Q&A

What precautions should be taken when handling N-Acetyl 6-Chlorotryptophan (CAS: 50517-10-7)?

N-Acetyl 6-Chlorotryptophan (CAS: 50517-10-7) should be handled with care due to its reactivity. It ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...