Compound Q&A

What are the main uses of N-[(2,3,5,6-Tetramethylphenyl)sulfonyl]alanine (CAS: 1009671-00-4)?

Answer

N-[(2,3,5,6-Tetramethylphenyl)sulfonyl]alanine
N-[(2,3,5,6-Tetramethylphenyl)sulfonyl]alanine is primarily used in pharmaceutical research as a building block for synthesizing other compounds. It is also utilized in the development of certain medical applications and as a reagent in chemical synthesis.

About

English Name N-[(2,3,5,6-Tetramethylphenyl)sulfonyl]alanine
Molecular Formula C13H19NO4S
Molecular Weight 285.36 g/mol
SMILES CC(NS(=O)(=O)c1c(C)c(C)cc(C)c1C)C(=O)O
InChIKey SVNVDQLSTLUUOY-UHFFFAOYSA-N
Last Updated: 2026-03-25 01:57

Related Q&A

Compound Q&A

What is N-[(2,3,5,6-Tetramethylphenyl)sulfonyl]alanine (CAS: 1009671-00-4)?

N-[(2,3,5,6-Tetramethylphenyl)sulfonyl]alanine is a synthetic amino acid derivative. It is character...

Compound Q&A

Is N-[(2,3,5,6-Tetramethylphenyl)sulfonyl]alanine (CAS: 1009671-00-4) safe?

N-[(2,3,5,6-Tetramethylphenyl)sulfonyl]alanine is generally considered safe when handled properly. H...

Compound Q&A

How should N-[(2,3,5,6-Tetramethylphenyl)sulfonyl]alanine (CAS: 1009671-00-4) be stored?

N-[(2,3,5,6-Tetramethylphenyl)sulfonyl]alanine should be stored in a cool, dry place to maintain its...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...