Compound Q&A

How should 2-Methyl-2-proanyl (4-phenyl-4-piperidinyl)carbamate (CAS: 178914-47-1) be stored?

Answer

2-Methyl-2-propanyl (4-phenyl-4-piperidinyl)carbamate
2-Methyl-2-proanyl (4-phenyl-4-piperidinyl)carbamate (CAS: 178914-47-1) should be stored in a cool, dry place away from direct sunlight and heat sources to prevent degradation. It should be kept in a tightly sealed container to maintain purity and minimize exposure to air and moisture. Storage at temperatures below 25°C is recommended to ensure stability.

About

English Name 2-Methyl-2-propanyl (4-phenyl-4-piperidinyl)carbamate
Molecular Formula C16H24N2O2
Molecular Weight 276.38 g/mol
SMILES CC(C)(C)OC(=O)NC1(CCNCC1)c2ccccc2
InChIKey ZPGFRFRXRVLSMF-UHFFFAOYSA-N
Last Updated: 2026-03-25 01:57

Related Q&A

Compound Q&A

What is 2-Methyl-2-propanyl (4-phenyl-4-piperidinyl)carbamate (CAS: 178914-47-1)?

2-Methyl-2-propanyl (4-phenyl-4-piperidinyl)carbamate (CAS: 178914-47-1) is a chemical compound with...

Compound Q&A

What are the main uses of 2-Methyl-2-propanyl (4-phenyl-4-piperidinyl)carbamate (CAS: 178914-47-1)?

2-Methyl-2-propanyl (4-phenyl-4-piperidinyl)carbamate (CAS: 178914-47-1) is primarily used in pharma...

Compound Q&A

Is 2-Methyl-2-proanyl (4-phenyl-4-piperidinyl)carbamate (CAS: 178914-47-1) safe?

2-Methyl-2-proanyl (4-phenyl-4-piperidinyl)carbamate (CAS: 178914-47-1) is generally considered safe...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...