Compound Q&A

What are the main uses of 2-Cyclopropyl-piperazine-1-carboxylic acid tert-butyl ester (CAS: 886779-93-7)?

Answer

2-Cyclopropyl-piperazine-1-carboxylic acid tert-butyl ester
2-Cyclopropyl-piperazine-1-carboxylic acid tert-butyl ester (CAS: 886779-93-7) is mainly used in the synthesis of pharmaceuticals and as a research reagent. It can be utilized in the development of new drugs and as an intermediate in the production of other chemical compounds.

About

English Name 2-Cyclopropyl-piperazine-1-carboxylic acid tert-butyl ester
Molecular Formula C12H22N2O2
Molecular Weight 226.32 g/mol
SMILES CC(C)(C)OC(=O)N1CCNCC1C2CC2
InChIKey WRKIMEBHYLJNGY-UHFFFAOYSA-N
Last Updated: 2026-03-24 17:56

Related Q&A

Compound Q&A

What is 2-Cyclopropyl-piperazine-1-carboxylic acid tert-butyl ester (CAS: 886779-93-7)?

2-Cyclopropyl-piperazine-1-carboxylic acid tert-butyl ester (CAS: 886779-93-7) is a chemical compoun...

Compound Q&A

Is 2-Cyclopropyl-piperazine-1-carboxylic acid tert-butyl ester (CAS: 886779-93-7) safe?

2-Cyclopropyl-piperazine-1-carboxylic acid tert-butyl ester (CAS: 886779-93-7) is generally safe whe...

Compound Q&A

How should 2-Cyclopropyl-piperazine-1-carboxylic acid tert-butyl ester (CAS: 886779-93-7) be stored?

2-Cyclopropyl-piperazine-1-carboxylic acid tert-butyl ester (CAS: 886779-93-7) should be stored in a...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...