Compound Q&A

Are there alternatives to 4-Phenyl-1H-pyrrole-2-carboxylic acid in synthesis?

Answer

4-Phenyl-1H-pyrrole-2-carboxylic acid
In synthesis, various alternatives to 4-Phenyl-1H-pyrrole-2-carboxylic acid (CAS: 79600-87-6) can be used, such as other substituted pyrroles or analogous carboxylic acids. For example, 3-Phenyl-1H-pyrrole-2-carboxylic acid and 2-Phenyl-1H-pyrrole-3-carboxylic acid are common alternatives. These can be chosen based on the specific reaction conditions and desired properties.

About

CAS No 79600-87-6
English Name 4-Phenyl-1H-pyrrole-2-carboxylic acid
Molecular Formula C11H9NO2
Molecular Weight 187.2 g/mol
SMILES OC(=O)c1cc(c[nH]1)c2ccccc2
InChIKey USTKWYVBYDXQPG-UHFFFAOYSA-N
Last Updated: 2026-03-24 09:14

Related Q&A

Compound Q&A

What regulatory guidelines apply to 4-Phenyl-1H-pyrrole-2-carboxylic acid (CAS: 79600-87-6)?

4-Phenyl-1H-pyrrole-2-carboxylic acid (CAS: 79600-87-6) falls under the scope of the Globally Harmon...

Compound Q&A

What is the market or research trend for 4-Phenyl-1H-pyrrole-2-carboxylic acid (CAS: 79600-87-6)?

The market for 4-Phenyl-1H-pyrrole-2-carboxylic acid (CAS: 79600-87-6) is currently focused on its u...

Compound Q&A

How should waste containing 4-Phenyl-1H-pyrrole-2-carboxylic acid (CAS: 79600-87-6) be handled?

Waste containing 4-Phenyl-1H-pyrrole-2-carboxylic acid (CAS: 79600-87-6) should be collected in appr...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...