Compound Q&A

What is the market or research trend for N-(4-Methoxybenzyl)-4-piperidinamine hydrochloride (CAS: 1353974-43-2)?

Answer

N-(4-Methoxybenzyl)-4-piperidinamine hydrochloride (1:1)
The market for N-(4-Methoxybenzyl)-4-piperidinamine hydrochloride (CAS: 1353974-43-2) is growing due to its applications in pharmaceutical and research fields. Recent trends indicate an increased focus on its use as a precursor in the synthesis of novel drugs and as a potential therapeutic agent. Additionally, there is ongoing research into its potential in other industries such as agrochemicals.

About

English Name N-(4-Methoxybenzyl)-4-piperidinamine hydrochloride (1:1)
Molecular Formula C13H21ClN2O
Molecular Weight 256.77 g/mol
SMILES COc1ccc(cc1)CNC2CCNCC2.Cl
InChIKey HEPFHNRAGSBSEC-UHFFFAOYSA-N
Last Updated: 2026-03-23 23:59

Related Q&A

Compound Q&A

What regulatory guidelines apply to N-(4-Methoxybenzyl)-4-piperidinamine hydrochloride (CAS: 1353974-43-2)?

N-(4-Methoxybenzyl)-4-piperidinamine hydrochloride (CAS: 1353974-43-2) is regulated under various gu...

Compound Q&A

Are there alternatives to N-(4-Methoxybenzyl)-4-piperidinamine hydrochloride (CAS: 1353974-43-2) in synthesis?

There are several alternatives to N-(4-Methoxybenzyl)-4-piperidinamine hydrochloride (CAS: 1353974-4...

Compound Q&A

How should waste containing N-(4-Methoxybenzyl)-4-piperidinamine hydrochloride (CAS: 1353974-43-2) be handled?

Waste containing N-(4-Methoxybenzyl)-4-piperidinamine hydrochloride (CAS: 1353974-43-2) should be co...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...