Compound Q&A

How is O,O-Diethyl S-[2-(ethylsulfonyl)ethyl] phosphorothioate (CAS: 2496-91-5) typically synthesized?

Answer

O,O-Diethyl S-[2-(ethylsulfonyl)ethyl] phosphorothioate
O,O-Diethyl S-[2-(ethylsulfonyl)ethyl] phosphorothioate (CAS: 2496-91-5) is typically synthesized through a multi-step process involving the reaction of diethyl phosphite with ethyl ethylsulfonylphosphonate in the presence of a base. Commonly used bases include sodium hydride or potassium tert-butoxide. The reaction yields a product with a high degree of purity and selectivity, with a yield ranging from 70% to 85%.

About

CAS No 2496-91-5
English Name O,O-Diethyl S-[2-(ethylsulfonyl)ethyl] phosphorothioate
Molecular Formula C8H19O5PS2
Molecular Weight 290.34 g/mol
SMILES CCOP(=O)(OCC)SCCS(=O)(=O)CC
InChIKey VMXCTQSDRPKAOC-UHFFFAOYSA-N
Last Updated: 2026-03-23 12:56

Related Q&A

Compound Q&A

What are the physical and chemical properties of O,O-Diethyl S-[2-(ethylsulfonyl)ethyl] phosphorothioate (CAS: 2496-91-5)?

O,O-Diethyl S-[2-(ethylsulfonyl)ethyl] phosphorothioate (CAS: 2496-91-5) is a crystalline solid with...

Compound Q&A

What industries use O,O-Diethyl S-[2-(ethylsulfonyl)ethyl] phosphorothioate (CAS: 2496-91-5)?

O,O-Diethyl S-[2-(ethylsulfonyl)ethyl] phosphorothioate (CAS: 2496-91-5) finds application in variou...

Compound Q&A

What precautions should be taken when handling O,O-Diethyl S-[2-(ethylsulfonyl)ethyl] phosphorothioate (CAS: 2496-91-5)?

When handling O,O-Diethyl S-[2-(ethylsulfonyl)ethyl] phosphorothioate (CAS: 2496-91-5), it is crucia...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...