Compound Q&A

What are the physical and chemical properties of 2-[(2E)-3,7-Dimethyl-2,6-octadien-1-yl]-5-propyl-1,3-benzenediol (CAS: 55824-11-8)?

Answer

2-[(2E)-3,7-Dimethyl-2,6-octadien-1-yl]-5-propyl-1,3-benzenediol
2-[(2E)-3,7-Dimethyl-2,6-octadien-1-yl]-5-propyl-1,3-benzenediol is a crystalline solid with a molecular weight of approximately 304.46 g/mol. It has a low water solubility and is moderately soluble in organic solvents like ethanol and acetone. The compound shows limited reactivity, with minimal tendency to undergo hydrolysis or oxidation under normal storage conditions.

About

CAS No 55824-11-8
English Name 2-[(2E)-3,7-Dimethyl-2,6-octadien-1-yl]-5-propyl-1,3-benzenediol
Molecular Formula C19H28O2
Molecular Weight 288.43 g/mol
SMILES CCCc1cc(c(c(c1)O)C/C=C(\C)/CCC=C(C)C)O
InChIKey YJYIDZLGVYOPGU-XNTDXEJSSA-N
Last Updated: 2026-03-23 08:16

Related Q&A

Compound Q&A

How is 2-[(2E)-3,7-Dimethyl-2,6-octadien-1-yl]-5-propyl-1,3-benzenediol (CAS: 55824-11-8) typically synthesized?

2-[(2E)-3,7-Dimethyl-2,6-octadien-1-yl]-5-propyl-1,3-benzenediol is typically synthesized via a mult...

Compound Q&A

What industries use 2-[(2E)-3,7-Dimethyl-2,6-octadien-1-yl]-5-propyl-1,3-benzenediol (CAS: 55824-11-8)?

2-[(2E)-3,7-Dimethyl-2,6-octadien-1-yl]-5-propyl-1,3-benzenediol finds applications in the pharmaceu...

Compound Q&A

What precautions should be taken when handling 2-[(2E)-3,7-Dimethyl-2,6-octadien-1-yl]-5-propyl-1,3-benzenediol (CAS: 55824-11-8)?

When handling 2-[(2E)-3,7-Dimethyl-2,6-octadien-1-yl]-5-propyl-1,3-benzenediol, it is recommended to...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...