Compound Q&A

What industries use 1-[(4-Isothiocyanatophenyl)sulfonyl]piperidine (CAS: 7356-55-0)?

Answer

1-[(4-Isothiocyanatophenyl)sulfonyl]piperidine
1-[(4-Isothiocyanatophenyl)sulfonyl]piperidine is used in the pharmaceutical industry for synthesis of certain drugs, in the polymer industry for developing functional polymers, and in the chemical sensor industry for the preparation of chemically sensitive materials. It is also utilized in the semiconductor industry for various applications.

About

CAS No 7356-55-0
English Name 1-[(4-Isothiocyanatophenyl)sulfonyl]piperidine
Molecular Formula C12H14N2O2S2
Molecular Weight 282.39000000000004 g/mol
SMILES C1CCN(CC1)S(=O)(=O)C2=CC=C(C=C2)N=C=S
InChIKey PMPSZAXEUCIVDC-UHFFFAOYSA-N
Last Updated: 2026-03-23 08:16

Related Q&A

Compound Q&A

What are the physical and chemical properties of 1-[(4-Isothiocyanatophenyl)sulfonyl]piperidine (CAS: 7356-55-0)?

1-[(4-Isothiocyanatophenyl)sulfonyl]piperidine is a crystalline solid with a molecular weight of app...

Compound Q&A

How is 1-[(4-Isothiocyanatophenyl)sulfonyl]piperidine (CAS: 7356-55-0) typically synthesized?

1-[(4-Isothiocyanatophenyl)sulfonyl]piperidine is typically synthesized through the reaction of 4-io...

Compound Q&A

What precautions should be taken when handling 1-[(4-Isothiocyanatophenyl)sulfonyl]piperidine (CAS: 7356-55-0)?

Handling 1-[(4-Isothiocyanatophenyl)sulfonyl]piperidine requires appropriate personal protective equ...

Compound Q&A

What are the main uses of (5-Sulfamoyl-3-pyridinyl)boronic acid (CAS: 951233-61-7)?

(5-Sulfamoyl-3-pyridinyl)boronic acid is primarily used in chemical synthesis, p...

951233-61-7(5-Sulfamoyl-3-pyrid...
Compound Q&A

How is Benzyl 2-methyl-2-(methylsulfonyl)-4-pentenoate (CAS: 1942858-50-5) typically synthesized?

Benzyl 2-methyl-2-(methylsulfonyl)-4-pentenoate is typically synthesized via est...

1942858-50-5Benzyl 2-methyl-2-(m...
Compound Q&A

What precautions should be taken when handling 8-Fluoroquinolin-6-ol (CAS: 209353-22-0)?

When handling 8-Fluoroquinolin-6-ol (CAS: 209353-22-0), it is important to use p...

209353-22-08-Fluoroquinolin-6-o...
Compound Q&A

What are the physical and chemical properties of 1,3-Dibromo-5-(2-methyl-2-propanyl)benzene (CAS: 129316-09-2)?

1,3-Dibromo-5-(2-methyl-2-propanyl)benzene (CAS: 129316-09-2) is a crystalline c...

129316-09-21,3-Dibromo-5-(2-met...