Compound Q&A

What are the physical and chemical properties of 1-[(4-Isothiocyanatophenyl)sulfonyl]piperidine (CAS: 7356-55-0)?

Answer

1-[(4-Isothiocyanatophenyl)sulfonyl]piperidine
1-[(4-Isothiocyanatophenyl)sulfonyl]piperidine is a crystalline solid with a molecular weight of approximately 361.3 g/mol. It is poorly soluble in water but soluble in organic solvents like methanol, ethanol, and acetonitrile. It is reactive towards nucleophiles and can undergo sulfonamide-like reactions. The compound is stable under normal conditions but should be stored in a cool, dry place away from direct sunlight and moisture.

About

CAS No 7356-55-0
English Name 1-[(4-Isothiocyanatophenyl)sulfonyl]piperidine
Molecular Formula C12H14N2O2S2
Molecular Weight 282.39000000000004 g/mol
SMILES C1CCN(CC1)S(=O)(=O)C2=CC=C(C=C2)N=C=S
InChIKey PMPSZAXEUCIVDC-UHFFFAOYSA-N
Last Updated: 2026-03-23 08:16

Related Q&A

Compound Q&A

How is 1-[(4-Isothiocyanatophenyl)sulfonyl]piperidine (CAS: 7356-55-0) typically synthesized?

1-[(4-Isothiocyanatophenyl)sulfonyl]piperidine is typically synthesized through the reaction of 4-io...

Compound Q&A

What industries use 1-[(4-Isothiocyanatophenyl)sulfonyl]piperidine (CAS: 7356-55-0)?

1-[(4-Isothiocyanatophenyl)sulfonyl]piperidine is used in the pharmaceutical industry for synthesis ...

Compound Q&A

What precautions should be taken when handling 1-[(4-Isothiocyanatophenyl)sulfonyl]piperidine (CAS: 7356-55-0)?

Handling 1-[(4-Isothiocyanatophenyl)sulfonyl]piperidine requires appropriate personal protective equ...

Compound Q&A

What are the main uses of (5-Sulfamoyl-3-pyridinyl)boronic acid (CAS: 951233-61-7)?

(5-Sulfamoyl-3-pyridinyl)boronic acid is primarily used in chemical synthesis, p...

951233-61-7(5-Sulfamoyl-3-pyrid...
Compound Q&A

How is Benzyl 2-methyl-2-(methylsulfonyl)-4-pentenoate (CAS: 1942858-50-5) typically synthesized?

Benzyl 2-methyl-2-(methylsulfonyl)-4-pentenoate is typically synthesized via est...

1942858-50-5Benzyl 2-methyl-2-(m...
Compound Q&A

What precautions should be taken when handling 8-Fluoroquinolin-6-ol (CAS: 209353-22-0)?

When handling 8-Fluoroquinolin-6-ol (CAS: 209353-22-0), it is important to use p...

209353-22-08-Fluoroquinolin-6-o...
Compound Q&A

What are the physical and chemical properties of 1,3-Dibromo-5-(2-methyl-2-propanyl)benzene (CAS: 129316-09-2)?

1,3-Dibromo-5-(2-methyl-2-propanyl)benzene (CAS: 129316-09-2) is a crystalline c...

129316-09-21,3-Dibromo-5-(2-met...