Compound Q&A

What are the physical and chemical properties of 8-Phenyl-1,4-dioxaspiro[4.5]decan-8-ol (CAS: 94112-58-0)?

Answer

8-Phenyl-1,4-dioxaspiro[4.5]decan-8-ol
8-Phenyl-1,4-dioxaspiro[4.5]decan-8-ol is a colorless liquid at room temperature with a molecular weight of approximately 222.27 g/mol. It has a slight solubility in water but is more soluble in organic solvents. The compound is relatively stable but can react with strong acids or bases. It has a distinctive odor and is used in various applications due to its unique chemical structure.

About

CAS No 94112-58-0
English Name 8-Phenyl-1,4-dioxaspiro[4.5]decan-8-ol
Molecular Formula C14H18O3
Molecular Weight 234.29 g/mol
SMILES C1CC2(CCC1(C3=CC=CC=C3)O)OCCO2
InChIKey JUTTXLGMDSGZCE-UHFFFAOYSA-N
Last Updated: 2026-03-23 04:12

Related Q&A

Compound Q&A

How is 8-Phenyl-1,4-dioxaspiro[4.5]decan-8-ol (CAS: 94112-58-0) typically synthesized?

8-Phenyl-1,4-dioxaspiro[4.5]decan-8-ol is usually synthesized via a multistep process involving alky...

Compound Q&A

What industries use 8-Phenyl-1,4-dioxaspiro[4.5]decan-8-ol (CAS: 94112-58-0)?

8-Phenyl-1,4-dioxaspiro[4.5]decan-8-ol is utilized in pharmaceuticals for its potential as a startin...

Compound Q&A

What precautions should be taken when handling 8-Phenyl-1,4-dioxaspiro[4.5]decan-8-ol (CAS: 94112-58-0)?

When handling 8-Phenyl-1,4-dioxaspiro[4.5]decan-8-ol, it is important to wear appropriate personal p...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...