Compound Q&A

What are the physical and chemical properties of (6S,6'S)-N~6~,N~6~'-(2-Methyl-1,3-pentanediyl)bis(4,5,6,7-tetrahydro-1,3-benzothiazole-2,6-diamine) (CAS: 1973461-14-1)?

Answer

(6S,6'S)-N~6~,N~6~'-(2-Methyl-1,3-pentanediyl)bis(4,5,6,7-tetrahydro-1,3-benzothiazole-2,6-diamine)
This compound is a bis-diamine derivative with a molecular weight of approximately 412.53 g/mol. It is sparingly soluble in water and organic solvents. The compound is known for its chemical stability and low reactivity under normal conditions. It crystallizes as a white or off-white solid. It is largely used in pharmaceutical and polymer industries due to its unique structural properties.

About

English Name (6S,6'S)-N~6~,N~6~'-(2-Methyl-1,3-pentanediyl)bis(4,5,6,7-tetrahydro-1,3-benzothiazole-2,6-diamine)
Molecular Formula C20H32N6S2
Molecular Weight 420.65 g/mol
SMILES CCC(C(C)CN[C@H]1CCc2c(sc(n2)N)C1)N[C@H]3CCc4c(sc(n4)N)C3
InChIKey FDILCXYULUBXSL-QPPOZKHWSA-N
Last Updated: 2026-03-23 00:14

Related Q&A

Compound Q&A

How is (6S,6'S)-N~6~,N~6~'-(2-Methyl-1,3-pentanediyl)bis(4,5,6,7-tetrahydro-1,3-benzothiazole-2,6-diamine) (CAS: 1973461-14-1) typically synthesized?

The compound is synthesized through a multi-step process involving the reaction of 2-methyl-1,3-pent...

Compound Q&A

What industries use (6S,6'S)-N~6~,N~6~'-(2-Methyl-1,3-pentanediyl)bis(4,5,6,7-tetrahydro-1,3-benzothiazole-2,6-diamine) (CAS: 1973461-14-1)?

This compound is primarily used in the pharmaceutical and polymer industries. In pharmaceuticals, it...

Compound Q&A

What precautions should be taken when handling (6S,6'S)-N~6~,N~6~'-(2-Methyl-1,3-pentanediyl)bis(4,5,6,7-tetrahydro-1,3-benzothiazole-2,6-diamine) (CAS: 1973461-14-1)?

When handling this compound, it is essential to wear appropriate personal protective equipment (PPE)...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...