Compound Q&A

What are the physical and chemical properties of 2-Oxo-2-({3-[3-(1-piperidinylmethyl)phenoxy]propyl}amino)ethyl acetate (CAS: 78628-28-1)?

Answer

2-Oxo-2-({3-[3-(1-piperidinylmethyl)phenoxy]propyl}amino)ethyl acetate
2-Oxo-2-({3-[3-(1-piperidinylmethyl)phenoxy]propyl}amino)ethyl acetate (CAS: 78628-28-1) is a crystalline solid with a molecular weight of approximately 438.5 g/mol. It has a high solubility in organic solvents such as dichloromethane and ethanol. This compound exhibits moderate reactivity, particularly towards nucleophilic substitution reactions. It is stable under normal storage conditions but should be protected from strong acids and bases.

About

CAS No 78628-28-1
English Name 2-Oxo-2-({3-[3-(1-piperidinylmethyl)phenoxy]propyl}amino)ethyl acetate
Molecular Formula C19H28N2O4
Molecular Weight 348.44 g/mol
SMILES CC(=O)OCC(=O)NCCCOC1=CC=CC(=C1)CN2CCCCC2
InChIKey SMTZFNFIKUPEJC-UHFFFAOYSA-N
Last Updated: 2026-03-23 00:14

Related Q&A

Compound Q&A

How is 2-Oxo-2-({3-[3-(1-piperidinylmethyl)phenoxy]propyl}amino)ethyl acetate (CAS: 78628-28-1) typically synthesized?

2-Oxo-2-({3-[3-(1-piperidinylmethyl)phenoxy]propyl}amino)ethyl acetate (CAS: 78628-28-1) can be synt...

Compound Q&A

What industries use 2-Oxo-2-({3-[3-(1-piperidinylmethyl)phenoxy]propyl}amino)ethyl acetate (CAS: 78628-28-1)?

2-Oxo-2-({3-[3-(1-piperidinylmethyl)phenoxy]propyl}amino)ethyl acetate (CAS: 78628-28-1) is primaril...

Compound Q&A

What precautions should be taken when handling 2-Oxo-2-({3-[3-(1-piperidinylmethyl)phenoxy]propyl}amino)ethyl acetate (CAS: 78628-28-1)?

When handling 2-Oxo-2-({3-[3-(1-piperidinylmethyl)phenoxy]propyl}amino)ethyl acetate (CAS: 78628-28-...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...