Compound Q&A

What are the physical and chemical properties of triphenylsulfonium chloride solution (CAS: 109037-76-5)?

Answer

Triphenylsulfonium chloride solution
Triphenylsulfonium chloride solution has a yellow or amber color. It is highly soluble in water and organic solvents. The molecular weight is approximately 332.4 g/mol. It is stable under normal conditions but reacts with strong bases and reducing agents. It is used as a catalyst in certain organic reactions.

About

English Name Triphenylsulfonium chloride solution
Molecular Formula C6H6Cl4S2
Molecular Weight 284.1 g/mol
SMILES C1=CC=CC=C1.S(SCl)Cl.ClCl
InChIKey VWQDLARRABLIAP-UHFFFAOYSA-N
Last Updated: 2026-03-22 19:38

Related Q&A

Compound Q&A

How is triphenylsulfonium chloride solution (CAS: 109037-76-5) typically synthesized?

Triphenylsulfonium chloride solution is typically synthesized by reacting triphenyl sulfonium bromid...

Compound Q&A

What industries use triphenylsulfonium chloride solution (CAS: 109037-76-5)?

Triphenylsulfonium chloride solution is used in the pharmaceutical industry for the synthesis of cer...

Compound Q&A

What precautions should be taken when handling triphenylsulfonium chloride solution (CAS: 109037-76-5)?

When handling triphenylsulfonium chloride solution, use appropriate personal protective equipment (P...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...