Compound Q&A

How is 2-Methyl-2-propanyl 3,3-difluorocyclobutanecarboxylate (CAS: 1355070-36-8) typically synthesized?

Answer

2-Methyl-2-propanyl 3,3-difluorocyclobutanecarboxylate
2-Methyl-2-propanyl 3,3-difluorocyclobutanecarboxylate (CAS: 1355070-36-8) is typically synthesized via a multi-step process involving the protection of a carboxylic acid, followed by a fluorination step to introduce the difluoro groups. Commonly, this involves using aluminum fluoride in anhydrous conditions, with high selectivity and yield. The exact conditions can vary depending on the starting materials and desired purity.

About

English Name 2-Methyl-2-propanyl 3,3-difluorocyclobutanecarboxylate
Molecular Formula C9H14F2O2
Molecular Weight 192.20499999999993 g/mol
SMILES CC(C)(C)OC(=O)C1CC(C1)(F)F
InChIKey OZPULKRYCWPXKS-UHFFFAOYSA-N
Last Updated: 2026-03-22 14:59

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-Methyl-2-propanyl 3,3-difluorocyclobutanecarboxylate (CAS: 1355070-36-8)?

2-Methyl-2-propanyl 3,3-difluorocyclobutanecarboxylate (CAS: 1355070-36-8) is a colorless liquid wit...

Compound Q&A

What industries use 2-Methyl-2-propanyl 3,3-difluorocyclobutanecarboxylate (CAS: 1355070-36-8)?

2-Methyl-2-propanyl 3,3-difluorocyclobutanecarboxylate (CAS: 1355070-36-8) is primarily used in the ...

Compound Q&A

What precautions should be taken when handling 2-Methyl-2-propanyl 3,3-difluorocyclobutanecarboxylate (CAS: 1355070-36-8)?

When handling 2-Methyl-2-propanyl 3,3-difluorocyclobutanecarboxylate (CAS: 1355070-36-8), it is impo...

Compound Q&A

What are the main uses of Methyl cellulose (CAS: 9004-67-5)?

Methyl cellulose is widely used in pharmaceuticals as a binder and disintegrant ...

9004-67-5Methyl cellulose
Compound Q&A

How is Methyl 1-(aminomethyl)cyclopropanecarboxylate hydrochloride (CAS: 1170782-90-7) typically synthesized?

Methyl 1-(aminomethyl)cyclopropanecarboxylate hydrochloride is typically synthes...

1170782-90-7Methyl 1-(aminomethy...
Compound Q&A

How should Ethyl 3-aminofuro[2,3-b]pyridine-2-carboxylate (CAS: 371945-06-1) be stored?

Ethyl 3-aminofuro[2,3-b]pyridine-2-carboxylate should be stored in a cool, dry p...

371945-06-1Ethyl 3-aminofuro[2,...
Compound Q&A

What are the main uses of (2,4-Difluoro-3-isopropoxyphenyl)boronic acid (CAS: 1451390-95-6)?

(2,4-Difluoro-3-isopropoxyphenyl)boronic acid is primarily used in organic synth...

1451390-95-6(2,4-Difluoro-3-isop...