Compound Q&A

What are the physical and chemical properties of 2-Methyl-2-propanyl 3,3-difluorocyclobutanecarboxylate (CAS: 1355070-36-8)?

Answer

2-Methyl-2-propanyl 3,3-difluorocyclobutanecarboxylate
2-Methyl-2-propanyl 3,3-difluorocyclobutanecarboxylate (CAS: 1355070-36-8) is a colorless liquid with a molecular weight of approximately 186.07 g/mol. It has a low boiling point and is slightly soluble in water. The compound is known for its reactivity in organic synthesis, particularly in reactions involving nucleophiles. It shows minimal reactivity towards common acids and bases, making it suitable for a variety of chemical transformations.

About

English Name 2-Methyl-2-propanyl 3,3-difluorocyclobutanecarboxylate
Molecular Formula C9H14F2O2
Molecular Weight 192.20499999999993 g/mol
SMILES CC(C)(C)OC(=O)C1CC(C1)(F)F
InChIKey OZPULKRYCWPXKS-UHFFFAOYSA-N
Last Updated: 2026-03-22 14:59

Related Q&A

Compound Q&A

How is 2-Methyl-2-propanyl 3,3-difluorocyclobutanecarboxylate (CAS: 1355070-36-8) typically synthesized?

2-Methyl-2-propanyl 3,3-difluorocyclobutanecarboxylate (CAS: 1355070-36-8) is typically synthesized ...

Compound Q&A

What industries use 2-Methyl-2-propanyl 3,3-difluorocyclobutanecarboxylate (CAS: 1355070-36-8)?

2-Methyl-2-propanyl 3,3-difluorocyclobutanecarboxylate (CAS: 1355070-36-8) is primarily used in the ...

Compound Q&A

What precautions should be taken when handling 2-Methyl-2-propanyl 3,3-difluorocyclobutanecarboxylate (CAS: 1355070-36-8)?

When handling 2-Methyl-2-propanyl 3,3-difluorocyclobutanecarboxylate (CAS: 1355070-36-8), it is impo...

Compound Q&A

What are the main uses of Methyl cellulose (CAS: 9004-67-5)?

Methyl cellulose is widely used in pharmaceuticals as a binder and disintegrant ...

9004-67-5Methyl cellulose
Compound Q&A

How is Methyl 1-(aminomethyl)cyclopropanecarboxylate hydrochloride (CAS: 1170782-90-7) typically synthesized?

Methyl 1-(aminomethyl)cyclopropanecarboxylate hydrochloride is typically synthes...

1170782-90-7Methyl 1-(aminomethy...
Compound Q&A

How should Ethyl 3-aminofuro[2,3-b]pyridine-2-carboxylate (CAS: 371945-06-1) be stored?

Ethyl 3-aminofuro[2,3-b]pyridine-2-carboxylate should be stored in a cool, dry p...

371945-06-1Ethyl 3-aminofuro[2,...
Compound Q&A

What are the main uses of (2,4-Difluoro-3-isopropoxyphenyl)boronic acid (CAS: 1451390-95-6)?

(2,4-Difluoro-3-isopropoxyphenyl)boronic acid is primarily used in organic synth...

1451390-95-6(2,4-Difluoro-3-isop...