Compound Q&A

How is 2,2',3,3',6-Pentachlorobiphenyl (CAS: 52663-60-2) typically synthesized?

Answer

2,2',3,3',6-Pentachlorobiphenyl
2,2',3,3',6-Pentachlorobiphenyl is synthesized through a chlorination process, where biphenyl is chlorinated using chlorine gas under controlled conditions. This process often requires the use of a catalyst like iron or copper salts to improve yield and selectivity. The overall reaction is exothermic and should be carried out in a well-ventilated area.

About

CAS No 52663-60-2
English Name 2,2',3,3',6-Pentachlorobiphenyl
Molecular Formula C12H5Cl5
Molecular Weight 326.44 g/mol
SMILES C1=CC(=C(C(=C1)Cl)Cl)C2=C(C=CC(=C2Cl)Cl)Cl
InChIKey QVWUJLANSDKRAH-UHFFFAOYSA-N
Last Updated: 2026-03-22 14:59

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2,2',3,3',6-Pentachlorobiphenyl (CAS: 52663-60-2)?

2,2',3,3',6-Pentachlorobiphenyl is a colorless to white crystalline solid with a molecular weight of...

Compound Q&A

What industries use 2,2',3,3',6-Pentachlorobiphenyl (CAS: 52663-60-2)?

2,2',3,3',6-Pentachlorobiphenyl has been used in the production of heat-resistant paints and varnish...

Compound Q&A

What precautions should be taken when handling 2,2',3,3',6-Pentachlorobiphenyl (CAS: 52663-60-2)?

When handling 2,2',3,3',6-Pentachlorobiphenyl, it is essential to wear appropriate personal protecti...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...