Compound Q&A

What is 2-[4-(Trifluoromethyl)phenoxy]propanoic acid (CAS: 69484-34-0)?

Answer

2-[4-(Trifluoromethyl)phenoxy]propanoic acid
2-[4-(Trifluoromethyl)phenoxy]propanoic acid (CAS: 69484-34-0) is an organic compound with a unique structure that includes a trifluoromethyl group and a phenoxyl group. It is a white or off-white crystalline solid with a pungent odor. This compound is characterized by its high stability and specific reactivity, making it valuable in various applications.

About

CAS No 69484-34-0
English Name 2-[4-(Trifluoromethyl)phenoxy]propanoic acid
Molecular Formula C10H9F3O3
Molecular Weight 234.17 g/mol
SMILES CC(C(=O)O)OC1=CC=C(C=C1)C(F)(F)F
InChIKey ZZCGVEYHZSLNKD-UHFFFAOYSA-N
Last Updated: 2026-03-22 10:47

Related Q&A

Compound Q&A

What are the main uses of 2-[4-(Trifluoromethyl)phenoxy]propanoic acid (CAS: 69484-34-0)?

2-[4-(Trifluoromethyl)phenoxy]propanoic acid (CAS: 69484-34-0) is primarily used in the pharmaceutic...

Compound Q&A

Is 2-[4-(Trifluoromethyl)phenoxy]propanoic acid (CAS: 69484-34-0) safe?

2-[4-(Trifluoromethyl)phenoxy]propanoic acid (CAS: 69484-34-0) is generally considered safe when han...

Compound Q&A

How should 2-[4-(Trifluoromethyl)phenoxy]propanoic acid (CAS: 69484-34-0) be stored?

2-[4-(Trifluoromethyl)phenoxy]propanoic acid (CAS: 69484-34-0) should be stored in a cool, dark plac...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...