Compound Q&A

What is 4-(4-Acetyl-phenoxy)-butyric acid (CAS: 65623-82-7)?

Answer

4-(4-Acetyl-phenoxy)-butyric acid
4-(4-Acetyl-phenoxy)-butyric acid (CAS: 65623-82-7) is an organic compound with the molecular formula C12H13NO3. It is a derivative of butyric acid with a substituted phenolic group and an acetyl group. This compound is known for its distinctive odor and is used in various applications such as pharmaceuticals, pesticides, and as a research tool.

About

CAS No 65623-82-7
English Name 4-(4-Acetyl-phenoxy)-butyric acid
Molecular Formula C12H14O4
Molecular Weight 222.24 g/mol
SMILES CC(=O)C1=CC=C(C=C1)OCCCC(=O)O
InChIKey FNHIEZKOCYDCOH-UHFFFAOYSA-N
Last Updated: 2026-03-22 07:40

Related Q&A

Compound Q&A

What are the main uses of 4-(4-Acetyl-phenoxy)-butyric acid (CAS: 65623-82-7)?

4-(4-Acetyl-phenoxy)-butyric acid (CAS: 65623-82-7) is primarily used in the pharmaceutical industry...

Compound Q&A

Is 4-(4-Acetyl-phenoxy)-butyric acid (CAS: 65623-82-7) safe?

4-(4-Acetyl-phenoxy)-butyric acid (CAS: 65623-82-7) is generally considered safe under normal handli...

Compound Q&A

How should 4-(4-Acetyl-phenoxy)-butyric acid (CAS: 65623-82-7) be stored?

4-(4-Acetyl-phenoxy)-butyric acid (CAS: 65623-82-7) should be stored in a cool, dry place away from ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...