Compound Q&A

What is (3β,20E)-24-Norchola-5,20(22)-diene-3,23-diol (CAS: 53495-21-9)?

Answer

(3β,20E)-24-Norchola-5,20(22)-diene-3,23-diol
(3β,20E)-24-Norchola-5,20(22)-diene-3,23-diol is a complex triterpenoid compound. It is an unsaturated diol with a specific carbon structure that includes a double bond at positions 5 and 20 (or 22). This compound has a molecular formula of C30H48O2 and is known for its potential use in natural product chemistry and as a precursor in synthetic organic chemistry.

About

CAS No 53495-21-9
English Name (3β,20E)-24-Norchola-5,20(22)-diene-3,23-diol
Molecular Formula C23H36O2
Molecular Weight 344.54 g/mol
SMILES CC(=CCO)C1CC[C@H]2[C@@H]3CC=C4CC(O)CC[C@]4(C)[C@@H]3CC[C@]12C
InChIKey IWNPVBBKCLEUDB-SOIIICCTSA-N
Last Updated: 2026-03-22 07:40

Related Q&A

Compound Q&A

What are the main uses of (3β,20E)-24-Norchola-5,20(22)-diene-3,23-diol (CAS: 53495-21-9)?

(3β,20E)-24-Norchola-5,20(22)-diene-3,23-diol is primarily used in natural product chemistry for the...

Compound Q&A

Is (3β,20E)-24-Norchola-5,20(22)-diene-3,23-diol (CAS: 53495-21-9) safe?

The safety of (3β,20E)-24-Norchola-5,20(22)-diene-3,23-diol depends on the context of its use. It is...

Compound Q&A

How should (3β,20E)-24-Norchola-5,20(22)-diene-3,23-diol (CAS: 53495-21-9) be stored?

(3β,20E)-24-Norchola-5,20(22)-diene-3,23-diol should be stored in a cool, dry place away from direct...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...