Compound Q&A

What is (1R)-2-{[(2-Methyl-2-propanyl)oxy]carbonyl}-5-(methylsulfonyl)-1-isoindolinecarboxylic acid (CAS: 2101238-70-2)?

Answer

(1R)-2-{[(2-Methyl-2-propanyl)oxy]carbonyl}-5-(methylsulfonyl)-1-isoindolinecarboxylic acid
It is a chemical compound with the CAS number 2101238-70-2, known as (1R)-2-{[(2-Methyl-2-propanyl)oxy]carbonyl}-5-(methylsulfonyl)-1-isoindolinecarboxylic acid. This compound is characterized by its unique structure and has potential applications in pharmaceuticals and research.

About

English Name (1R)-2-{[(2-Methyl-2-propanyl)oxy]carbonyl}-5-(methylsulfonyl)-1-isoindolinecarboxylic acid
Molecular Formula C15H19NO6S
Molecular Weight 341.39 g/mol
SMILES CC(C)(C)OC(=O)N1CC2=C(C=CC(=C2)S(C)(=O)=O)[C@@H]1C(O)=O
InChIKey UEXJCBSEXADJCE-GFCCVEGCSA-N
Last Updated: 2026-03-22 07:39

Related Q&A

Compound Q&A

What are the main uses of (1R)-2-{[(2-Methyl-2-propanyl)oxy]carbonyl}-5-(methylsulfonyl)-1-isoindolinecarboxylic acid (CAS: 2101238-70-2)?

This compound is primarily used in pharmaceutical research and development, particularly in the synt...

Compound Q&A

Is (1R)-2-{[(2-Methyl-2-propanyl)oxy]carbonyl}-5-(methylsulfonyl)-1-isoindolinecarboxylic acid (CAS: 2101238-70-2) safe?

While the compound is generally safe under proper handling conditions, it is important to follow saf...

Compound Q&A

How should (1R)-2-{[(2-Methyl-2-propanyl)oxy]carbonyl}-5-(methylsulfonyl)-1-isoindolinecarboxylic acid (CAS: 2101238-70-2) be stored?

Store this compound in a cool, dry place, away from direct sunlight and sources of ignition. Keep it...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...