Compound Q&A

What is (2S)-(2-Chlorophenyl){[2-(2-thienyl)ethyl]amino}acetic acid (CAS: 1015247-87-6)?

Answer

(2S)-(2-Chlorophenyl){[2-(2-thienyl)ethyl]amino}acetic acid
(2S)-(2-Chlorophenyl){[2-(2-thienyl)ethyl]amino}acetic acid is an organic compound with the CAS number 1015247-87-6. It is characterized by its molecular structure and chemical properties including solubility and reactivity. This compound is used in various applications such as pharmaceuticals and research.

About

English Name (2S)-(2-Chlorophenyl){[2-(2-thienyl)ethyl]amino}acetic acid
Molecular Formula C14H14ClNO2S
Molecular Weight 295.79 g/mol
SMILES OC(=O)[C@H](c1ccccc1Cl)NCCc1cccs1
InChIKey LXVSWSGFEJYTPS-ZDUSSCGKSA-N
Last Updated: 2026-03-22 07:39

Related Q&A

Compound Q&A

What are the main uses of (2S)-(2-Chlorophenyl){[2-(2-thienyl)ethyl]amino}acetic acid (CAS: 1015247-87-6)?

(2S)-(2-Chlorophenyl){[2-(2-thienyl)ethyl]amino}acetic acid is primarily used in pharmaceuticals and...

Compound Q&A

Is (2S)-(2-Chlorophenyl){[2-(2-thienyl)ethyl]amino}acetic acid (CAS: 1015247-87-6) safe?

(2S)-(2-Chlorophenyl){[2-(2-thienyl)ethyl]amino}acetic acid is generally considered safe when handle...

Compound Q&A

How should (2S)-(2-Chlorophenyl){[2-(2-thienyl)ethyl]amino}acetic acid (CAS: 1015247-87-6) be stored?

(2S)-(2-Chlorophenyl){[2-(2-thienyl)ethyl]amino}acetic acid should be stored in a cool, dry place, a...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...