Compound Q&A

What is Bis(2-methyl-2-propanyl) (4-bromo-1,2-phenylene)biscarbamate (CAS: 471239-60-8)?

Answer

Bis(2-methyl-2-propanyl) (4-bromo-1,2-phenylene)biscarbamate
Bis(2-methyl-2-propanyl) (4-bromo-1,2-phenylene)biscarbamate is a chemical compound with the CAS number 471239-60-8. It is a carbamate derivative with a bromine substituent on the phenylene ring. This compound is primarily used in research and industrial applications due to its unique chemical properties.

About

English Name Bis(2-methyl-2-propanyl) (4-bromo-1,2-phenylene)biscarbamate
Molecular Formula C16H23BrN2O4
Molecular Weight 387.27 g/mol
SMILES Brc1ccc(c(c1)NC(=O)OC(C)(C)C)NC(=O)OC(C)(C)C
InChIKey LJKCSTXFYRULGQ-UHFFFAOYSA-N
Last Updated: 2026-03-22 07:39

Related Q&A

Compound Q&A

What are the main uses of Bis(2-methyl-2-propanyl) (4-bromo-1,2-phenylene)biscarbamate (CAS: 471239-60-8)?

Bis(2-methyl-2-propanyl) (4-bromo-1,2-phenylene)biscarbamate is mainly used in research and developm...

Compound Q&A

Is Bis(2-methyl-2-propanyl) (4-bromo-1,2-phenylene)biscarbamate (CAS: 471239-60-8) safe?

When handled properly, Bis(2-methyl-2-propanyl) (4-bromo-1,2-phenylene)biscarbamate is generally con...

Compound Q&A

How should Bis(2-methyl-2-propanyl) (4-bromo-1,2-phenylene)biscarbamate (CAS: 471239-60-8) be stored?

Bis(2-methyl-2-propanyl) (4-bromo-1,2-phenylene)biscarbamate should be stored in a cool, dry place a...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...