Compound Q&A

What are the main uses of (S)-4-benzyl-2-((benzyloxy)methyl)morpholine (CAS: 205242-66-6)?

Answer

(S)-4-benzyl-2-((benzyloxy)methyl)morpholine
(S)-4-benzyl-2-((benzyloxy)methyl)morpholine is primarily used in the synthesis of pharmaceuticals and in biochemical research for its unique structural features that facilitate various chemical reactions.

About

English Name (S)-4-benzyl-2-((benzyloxy)methyl)morpholine
Molecular Formula C19H23NO2
Molecular Weight 297.3980000000001 g/mol
SMILES C1COC(CN1CC2=CC=CC=C2)COCC3=CC=CC=C3
InChIKey YIUOMOUSMWDPKQ-IBGZPJMESA-N
Last Updated: 2026-03-22 03:59

Related Q&A

Compound Q&A

What is (S)-4-benzyl-2-((benzyloxy)methyl)morpholine (CAS: 205242-66-6)?

(S)-4-benzyl-2-((benzyloxy)methyl)morpholine is a chiral compound with a benzyl group and a benzylox...

Compound Q&A

Is (S)-4-benzyl-2-((benzyloxy)methyl)morpholine (CAS: 205242-66-6) safe?

(S)-4-benzyl-2-((benzyloxy)methyl)morpholine is generally safe when handled with appropriate precaut...

Compound Q&A

How should (S)-4-benzyl-2-((benzyloxy)methyl)morpholine (CAS: 205242-66-6) be stored?

(S)-4-benzyl-2-((benzyloxy)methyl)morpholine should be stored in a cool, dry place, away from direct...

Compound Q&A

How is Ethyl 4-chlorothieno[2,3-b]pyridine-5-carboxylate (CAS: 59713-58-5) typically synthesized?

Ethyl 4-chlorothieno[2,3-b]pyridine-5-carboxylate (CAS: 59713-58-5) can be synth...

59713-58-5Ethyl 4-chlorothieno...
Compound Q&A

What regulatory guidelines apply to 5-Methyl-1H-indole-3-carbaldehyde (CAS: 52562-50-2)?

5-Methyl-1H-indole-3-carbaldehyde (CAS: 52562-50-2) is subject to various regula...

52562-50-25-Methyl-1H-indole-3...
Compound Q&A

What are the physical and chemical properties of (1,3-Dimethyl-2,4-dioxo-1,2,3,4-tetrahydro-5-pyrimidinyl)boronic acid (CAS: 223418-73-3)?

(1,3-Dimethyl-2,4-dioxo-1,2,3,4-tetrahydro-5-pyrimidinyl)boronic acid is a white...

223418-73-3(1,3-Dimethyl-2,4-di...
Compound Q&A

How should waste containing Sulfocostunolide A (CAS: 1016983-51-9) be handled?

Waste containing Sulfocostunolide A (CAS: 1016983-51-9) should be handled with c...

1016983-51-9Sulfocostunolide A