Compound Q&A

How should 1-Benzyl-1H-1,2,3-triazole-4,5-dicarboxylic acid (CAS: 73953-89-6) be stored?

Answer

1-Benzyl-1H-1,2,3-triazole-4,5-dicarboxylic acid
1-Benzyl-1H-1,2,3-triazole-4,5-dicarboxylic acid (CAS: 73953-89-6) should be stored in a cool, dry place away from heat and light to prevent degradation. Store it in a tightly sealed container to maintain its stability and purity. Avoid exposure to moisture and ensure proper ventilation during storage and handling.

About

CAS No 73953-89-6
English Name 1-Benzyl-1H-1,2,3-triazole-4,5-dicarboxylic acid
Molecular Formula C11H9N3O4
Molecular Weight 247.21 g/mol
SMILES C1=CC=C(C=C1)CN2C(=C(N=N2)C(=O)O)C(=O)O
InChIKey IYYBUXUZYWGZGB-UHFFFAOYSA-N
Last Updated: 2026-03-22 03:59

Related Q&A

Compound Q&A

What is 1-Benzyl-1H-1,2,3-triazole-4,5-dicarboxylic acid (CAS: 73953-89-6)?

1-Benzyl-1H-1,2,3-triazole-4,5-dicarboxylic acid (CAS: 73953-89-6) is a complex organic compound wit...

Compound Q&A

What are the main uses of 1-Benzyl-1H-1,2,3-triazole-4,5-dicarboxylic acid (CAS: 73953-89-6)?

The main uses of 1-Benzyl-1H-1,2,3-triazole-4,5-dicarboxylic acid include drug development, as a pre...

Compound Q&A

Is 1-Benzyl-1H-1,2,3-triazole-4,5-dicarboxylic acid (CAS: 73953-89-6) safe?

1-Benzyl-1H-1,2,3-triazole-4,5-dicarboxylic acid (CAS: 73953-89-6) is generally safe when handled wi...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...