Compound Q&A

What is Methyl (2-methyl-1H-pyrrolo[2,3-b]pyridin-3-yl)acetate (CAS: 7546-52-3)?

Answer

Methyl (2-methyl-1H-pyrrolo[2,3-b]pyridin-3-yl)acetate
Methyl (2-methyl-1H-pyrrolo[2,3-b]pyridin-3-yl)acetate (CAS: 7546-52-3) is a chemical compound with a complex structure featuring a pyrrolo[2,3-b]pyridine ring fused to an acetate moiety. It is typically colorless or light yellow in color and has a distinctive odor. This compound is known for its unique chemical properties and is used in various applications including pharmaceuticals and as a flavoring agent in food.

About

CAS No 7546-52-3
English Name Methyl (2-methyl-1H-pyrrolo[2,3-b]pyridin-3-yl)acetate
Molecular Formula C11H12N2O2
Molecular Weight 204.23 g/mol
SMILES CC1=C(C2=C(N1)N=CC=C2)CC(=O)OC
InChIKey YNBGGUBQXVTLST-UHFFFAOYSA-N
Last Updated: 2026-03-22 00:15

Related Q&A

Compound Q&A

What are the main uses of Methyl (2-methyl-1H-pyrrolo[2,3-b]pyridin-3-yl)acetate (CAS: 7546-52-3)?

Methyl (2-methyl-1H-pyrrolo[2,3-b]pyridin-3-yl)acetate (CAS: 7546-52-3) is primarily used in the pha...

Compound Q&A

Is Methyl (2-methyl-1H-pyrrolo[2,3-b]pyridin-3-yl)acetate (CAS: 7546-52-3) safe?

Methyl (2-methyl-1H-pyrrolo[2,3-b]pyridin-3-yl)acetate (CAS: 7546-52-3) is considered safe when hand...

Compound Q&A

How should Methyl (2-methyl-1H-pyrrolo[2,3-b]pyridin-3-yl)acetate (CAS: 7546-52-3) be stored?

Methyl (2-methyl-1H-pyrrolo[2,3-b]pyridin-3-yl)acetate (CAS: 7546-52-3) should be stored in a cool, ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...