Compound Q&A

What are the main uses of (3beta,5beta)-17-(3-Pyridinyl)androst-16-en-3-ol (CAS: 1940176-03-3)?

Answer

(3beta,5beta)-17-(3-Pyridinyl)androst-16-en-3-ol
(3beta,5beta)-17-(3-Pyridinyl)androst-16-en-3-ol is primarily used in pharmaceutical research for its potential as a prodrug or as a derivative in drug discovery. It also finds use in synthetic chemistry for the development of new compounds with specific biological activities.

About

English Name (3beta,5beta)-17-(3-Pyridinyl)androst-16-en-3-ol
Molecular Formula C24H33NO
Molecular Weight 351.53 g/mol
SMILES C[C@]12CC[C@@H](C[C@H]1CC[C@@H]3[C@@H]2CC[C@]4([C@H]3CC=C4c5cccnc5)C)O
InChIKey UNJQRCXVHBZVTM-JSIIKIRASA-N
Last Updated: 2026-03-22 00:15

Related Q&A

Compound Q&A

What is (3beta,5beta)-17-(3-Pyridinyl)androst-16-en-3-ol (CAS: 1940176-03-3)?

(3beta,5beta)-17-(3-Pyridinyl)androst-16-en-3-ol is a steroidal compound with a unique structure cha...

Compound Q&A

Is (3beta,5beta)-17-(3-Pyridinyl)androst-16-en-3-ol (CAS: 1940176-03-3) safe?

(3beta,5beta)-17-(3-Pyridinyl)androst-16-en-3-ol is generally considered safe when handled properly ...

Compound Q&A

How should (3beta,5beta)-17-(3-Pyridinyl)androst-16-en-3-ol (CAS: 1940176-03-3) be stored?

(3beta,5beta)-17-(3-Pyridinyl)androst-16-en-3-ol should be stored in a cool, dark place to prevent d...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...