Compound Q&A

What is 3-Bromo-6-(trifluoromethyl)-1H-pyrrolo[3,2-c]pyridine (CAS: 1190315-61-7)?

Answer

3-Bromo-6-(trifluoromethyl)-1H-pyrrolo[3,2-c]pyridine
3-Bromo-6-(trifluoromethyl)-1H-pyrrolo[3,2-c]pyridine is a heterocyclic compound with the CAS number 1190315-61-7. It features a pyrrolo[3,2-c]pyridine ring with a bromo and trifluoromethyl substituent. This compound is typically used in medicinal chemistry for its structural complexity and potential biological activity.

About

English Name 3-Bromo-6-(trifluoromethyl)-1H-pyrrolo[3,2-c]pyridine
Molecular Formula C8H4BrF3N2
Molecular Weight 265.03 g/mol
SMILES Brc1c[nH]c2c1cnc(c2)C(F)(F)F
InChIKey PFBFXIPUSOWQGJ-UHFFFAOYSA-N
Last Updated: 2026-03-21 20:48

Related Q&A

Compound Q&A

What are the main uses of 3-Bromo-6-(trifluoromethyl)-1H-pyrrolo[3,2-c]pyridine (CAS: 1190315-61-7)?

3-Bromo-6-(trifluoromethyl)-1H-pyrrolo[3,2-c]pyridine is primarily used as a synthetic intermediate ...

Compound Q&A

Is 3-Bromo-6-(trifluoromethyl)-1H-pyrrolo[3,2-c]pyridine (CAS: 1190315-61-7) safe?

3-Bromo-6-(trifluoromethyl)-1H-pyrrolo[3,2-c]pyridine is generally safe when handled with appropriat...

Compound Q&A

How should 3-Bromo-6-(trifluoromethyl)-1H-pyrrolo[3,2-c]pyridine (CAS: 1190315-61-7) be stored?

3-Bromo-6-(trifluoromethyl)-1H-pyrrolo[3,2-c]pyridine should be stored in a cool, dry place away fro...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...