Compound Q&A

What is 3-Methyl-1-propylpyridinium bis[(trifluoromethyl)sulfonyl]azanide (CAS: 817575-06-7)?

Answer

3-Methyl-1-propylpyridinium bis[(trifluoromethyl)sulfonyl]azanide
3-Methyl-1-propylpyridinium bis[(trifluoromethyl)sulfonyl]azanide is a quaternary ammonium salt with the CAS number 817575-06-7. It is a clear, colorless liquid with a high boiling point and low volatility. This compound features a pyridinium cation with a trifluoromethanesulfonylazanide anion, making it useful in various applications due to its stability and conductivity.

About

English Name 3-Methyl-1-propylpyridinium bis[(trifluoromethyl)sulfonyl]azanide
Molecular Formula C11H14F6N2O4S2
Molecular Weight 416.4 g/mol
SMILES CCC[N+]1=CC=CC(=C1)C.C(F)(F)(F)S(=O)(=O)[N-]S(=O)(=O)C(F)(F)F
InChIKey JNHAYTMSFWSOHN-UHFFFAOYSA-N
Last Updated: 2026-03-21 20:48

Related Q&A

Compound Q&A

What are the main uses of 3-Methyl-1-propylpyridinium bis[(trifluoromethyl)sulfonyl]azanide (CAS: 817575-06-7)?

3-Methyl-1-propylpyridinium bis[(trifluoromethyl)sulfonyl]azanide is primarily used in electrochemic...

Compound Q&A

Is 3-Methyl-1-propylpyridinium bis[(trifluoromethyl)sulfonyl]azanide (CAS: 817575-06-7) safe?

3-Methyl-1-propylpyridinium bis[(trifluoromethyl)sulfonyl]azanide is generally considered safe for u...

Compound Q&A

How should 3-Methyl-1-propylpyridinium bis[(trifluoromethyl)sulfonyl]azanide (CAS: 817575-06-7) be stored?

3-Methyl-1-propylpyridinium bis[(trifluoromethyl)sulfonyl]azanide should be stored in a cool, dry pl...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...