Compound Q&A

What are the main uses of Tanshinol B (CAS: 96839-29-1)?

Answer

Tanshinol B (CAS: 96839-29-1) is primarily used in pharmaceuticals for its potential in treating cardiovascular diseases, as well as in cosmetics for its antioxidant properties, and in dietary supplements for its health benefits.

About

CAS No 96839-29-1

English Name Tanshinol B

Molecular Formula C18H16O4

Molecular Weight 296.317245483398 g/mol

SMILES CC1=COC2=C1C(=O)C(=O)C3=C2C=CC4=C3CCCC4(C)O

InChIKey JVRKHBLVECIWMZ-UHFFFAOYSA-N

Last Updated: 2026-03-21 20:48

Related Q&A

Compound Q&A

What is Tanshinol B (CAS: 96839-29-1)?

Tanshinol B (CAS: 96839-29-1) is a natural compound extracted from the Chinese medicinal plant Salvi...

Compound Q&A

Is Tanshinol B (CAS: 96839-29-1) safe?

Tanshinol B (CAS: 96839-29-1) is generally considered safe when used as directed. However, it is imp...

Compound Q&A

How should Tanshinol B (CAS: 96839-29-1) be stored?

Tanshinol B (CAS: 96839-29-1) should be stored in a cool, dry place away from direct sunlight and mo...

Compound Q&A

Are there alternatives to 1-(4-Chlorophenyl)-N-hydroxymethanimine (CAS: 3848-36-0) in synthesis?

When considering alternatives to 1-(4-Chlorophenyl)-N-hydroxymethanimine (CAS: 3...

3848-36-01-(4-Chlorophenyl)-N...

Compound Q&A

How should (1R,9S,10S,12S,14E,16S,19R,20R,21S,22R)-3,9,21-Trihydroxy-5,10,12,14,16,20,22-heptamethyl-23,24-dioxatetracyclo[17.3.1.1~6,9~.0~2,7~]tetracosa-2,5,7,14-tetraen-4-one (CAS: 183202-73-5) be stored?

This compound should be stored in a cool, dry place away from direct sunlight. I...

183202-73-5(1R,9S,10S,12S,14E,1...

Compound Q&A

How is 3-(4-Bromophenyl)-5-(2-fluorophenyl)-1,2,4-oxadiazole (CAS: 419553-16-5) typically synthesized?

3-(4-Bromophenyl)-5-(2-fluorophenyl)-1,2,4-oxadiazole is synthesized through a m...

419553-16-53-(4-Bromophenyl)-5-...

Compound Q&A

How is 5-Chloro-2-(4-chlorophenyl)-4-methyl-6-[3-(1-piperidinyl)propoxy]pyrimidine (CAS: 1639220-19-1) typically synthesized?

5-Chloro-2-(4-chlorophenyl)-4-methyl-6-[3-(1-piperidinyl)propoxy]pyrimidine (CAS...

1639220-19-15-Chloro-2-(4-chloro...

What are the main uses of Tanshinol B (CAS: 96839-29-1)?

Answer

About

Related Q&A

What is Tanshinol B (CAS: 96839-29-1)?

Is Tanshinol B (CAS: 96839-29-1) safe?

How should Tanshinol B (CAS: 96839-29-1) be stored?

Are there alternatives to 1-(4-Chlorophenyl)-N-hydroxymethanimine (CAS: 3848-36-0) in synthesis?

How should (1R,9S,10S,12S,14E,16S,19R,20R,21S,22R)-3,9,21-Trihydroxy-5,10,12,14,16,20,22-heptamethyl-23,24-dioxatetracyclo[17.3.1.1~6,9~.0~2,7~]tetracosa-2,5,7,14-tetraen-4-one (CAS: 183202-73-5) be stored?

How is 3-(4-Bromophenyl)-5-(2-fluorophenyl)-1,2,4-oxadiazole (CAS: 419553-16-5) typically synthesized?

How is 5-Chloro-2-(4-chlorophenyl)-4-methyl-6-[3-(1-piperidinyl)propoxy]pyrimidine (CAS: 1639220-19-1) typically synthesized?

Suppliers

Shanghai Jieshukai Biotechnology Co., Ltd.

HePeng （ ShangHai ） Biotechnology Co Ltd

Shanghai Hansi Chemical Co., Ltd.

SiChuanWeiKeJi Biotechnology Co Ltd

ShangHaiJiZhiShengHua Technology Co Ltd

Shanghai Yuyeh Biotechnology Co., Ltd.