Compound Q&A

What is Tanshinol B (CAS: 96839-29-1)?

Answer

Tanshinol B
Tanshinol B (CAS: 96839-29-1) is a natural compound extracted from the Chinese medicinal plant Salvia miltiorrhiza, also known as red sage. It has a molecular formula of C15H14O4 and is characterized by its antioxidant and anti-inflammatory properties.

About

CAS No 96839-29-1
English Name Tanshinol B
Molecular Formula C18H16O4
Molecular Weight 296.317245483398 g/mol
SMILES CC1=COC2=C1C(=O)C(=O)C3=C2C=CC4=C3CCCC4(C)O
InChIKey JVRKHBLVECIWMZ-UHFFFAOYSA-N
Last Updated: 2026-03-21 20:48

Related Q&A

Compound Q&A

What are the main uses of Tanshinol B (CAS: 96839-29-1)?

Tanshinol B (CAS: 96839-29-1) is primarily used in pharmaceuticals for its potential in treating car...

Compound Q&A

Is Tanshinol B (CAS: 96839-29-1) safe?

Tanshinol B (CAS: 96839-29-1) is generally considered safe when used as directed. However, it is imp...

Compound Q&A

How should Tanshinol B (CAS: 96839-29-1) be stored?

Tanshinol B (CAS: 96839-29-1) should be stored in a cool, dry place away from direct sunlight and mo...

Compound Q&A

Are there alternatives to 1-(4-Chlorophenyl)-N-hydroxymethanimine (CAS: 3848-36-0) in synthesis?

When considering alternatives to 1-(4-Chlorophenyl)-N-hydroxymethanimine (CAS: 3...

3848-36-01-(4-Chlorophenyl)-N...
Compound Q&A

How is 3-(4-Bromophenyl)-5-(2-fluorophenyl)-1,2,4-oxadiazole (CAS: 419553-16-5) typically synthesized?

3-(4-Bromophenyl)-5-(2-fluorophenyl)-1,2,4-oxadiazole is synthesized through a m...

419553-16-53-(4-Bromophenyl)-5-...
Compound Q&A

How is 5-Chloro-2-(4-chlorophenyl)-4-methyl-6-[3-(1-piperidinyl)propoxy]pyrimidine (CAS: 1639220-19-1) typically synthesized?

5-Chloro-2-(4-chlorophenyl)-4-methyl-6-[3-(1-piperidinyl)propoxy]pyrimidine (CAS...

1639220-19-15-Chloro-2-(4-chloro...