Compound Q&A

What is 2-Methyl-2-propanyl (6-chloro-4-formyl-3-pyridinyl)carbamate (CAS: 1238324-67-8)?

Answer

2-Methyl-2-propanyl (6-chloro-4-formyl-3-pyridinyl)carbamate
2-Methyl-2-propanyl (6-chloro-4-formyl-3-pyridinyl)carbamate is a chemical compound with the CAS number 1238324-67-8. It is a carbamate derivative with a unique structure, consisting of a pyridine ring, a methyl-substituted propyl group, and a formyl group. It is typically used in pharmaceutical and research applications due to its distinctive chemical properties.

About

English Name 2-Methyl-2-propanyl (6-chloro-4-formyl-3-pyridinyl)carbamate
Molecular Formula C11H13ClN2O3
Molecular Weight 256.69 g/mol
SMILES CC(C)(C)OC(=O)Nc1cnc(Cl)cc1C=O
InChIKey GKFAVHZVKTXFTG-UHFFFAOYSA-N
Last Updated: 2026-03-21 16:59

Related Q&A

Compound Q&A

What are the main uses of 2-Methyl-2-propanyl (6-chloro-4-formyl-3-pyridinyl)carbamate (CAS: 1238324-67-8)?

2-Methyl-2-propanyl (6-chloro-4-formyl-3-pyridinyl)carbamate (CAS: 1238324-67-8) is primarily used i...

Compound Q&A

Is 2-Methyl-2-propanyl (6-chloro-4-formyl-3-pyridinyl)carbamate (CAS: 1238324-67-8) safe?

2-Methyl-2-propanyl (6-chloro-4-formyl-3-pyridinyl)carbamate (CAS: 1238324-67-8) may pose certain sa...

Compound Q&A

How should 2-Methyl-2-propanyl (6-chloro-4-formyl-3-pyridinyl)carbamate (CAS: 1238324-67-8) be stored?

2-Methyl-2-propanyl (6-chloro-4-formyl-3-pyridinyl)carbamate (CAS: 1238324-67-8) should be stored in...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...