Compound Q&A

What is [bromo(difluoro)methyl]sulfonyl benzene (CAS: 80351-58-2)?

Answer

{[Bromo(difluoro)methyl]sulfonyl}benzene
[Bromo(difluoro)methyl]sulfonyl benzene (CAS: 80351-58-2) is an organosulfur compound, featuring a benzene ring substituted with a [bromo(difluoro)methyl]sulfonyl group. It is known for its unique chemical structure and reactivity, making it valuable in various chemical syntheses and research applications.

About

CAS No 80351-58-2
English Name {[Bromo(difluoro)methyl]sulfonyl}benzene
Molecular Formula C7H5BrF2O2S
Molecular Weight 271.08 g/mol
SMILES FC(F)(Br)S(=O)(=O)c1ccccc1
InChIKey VYNTWHUALGNGNU-UHFFFAOYSA-N
Last Updated: 2026-03-21 16:59

Related Q&A

Compound Q&A

What are the main uses of [bromo(difluoro)methyl]sulfonyl benzene (CAS: 80351-58-2)?

[Bromo(difluoro)methyl]sulfonyl benzene (CAS: 80351-58-2) is primarily used in pharmaceutical resear...

Compound Q&A

Is [bromo(difluoro)methyl]sulfonyl benzene (CAS: 80351-58-2) safe?

[Bromo(difluoro)methyl]sulfonyl benzene (CAS: 80351-58-2) is generally safe when handled with approp...

Compound Q&A

How should [bromo(difluoro)methyl]sulfonyl benzene (CAS: 80351-58-2) be stored?

[Bromo(difluoro)methyl]sulfonyl benzene (CAS: 80351-58-2) should be stored in a cool, dry place, awa...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...