Compound Q&A

Are there alternatives to 2-Methyl-4-(trifluoromethoxy)benzoic acid in synthesis?

Answer

2-Methyl-4-(trifluoromethoxy)benzoic acid
In synthesis, 2-Methyl-4-(trifluoromethoxy)benzoic acid (CAS: 261951-91-1) can be replaced by similar compounds such as 4-(trifluoromethoxy)benzoic acid or 2-methylbenzoic acid. Other alternatives include using different reagents like trifluoromethylbenzoic acid or similar functional groups. These alternatives can offer similar reactivity while adapting to specific synthesis needs.

About

English Name 2-Methyl-4-(trifluoromethoxy)benzoic acid
Molecular Formula C9H7F3O3
Molecular Weight 220.14600000000002 g/mol
SMILES Cc1cc(OC(F)(F)F)ccc1C(=O)O
InChIKey GINWJGHZNRKJEK-UHFFFAOYSA-N
Last Updated: 2026-03-21 12:54

Related Q&A

Compound Q&A

What regulatory guidelines apply to 2-Methyl-4-(trifluoromethoxy)benzoic acid (CAS: 261951-91-1)?

Regulatory guidelines for 2-Methyl-4-(trifluoromethoxy)benzoic acid (CAS: 261951-91-1) include GHS c...

Compound Q&A

What is the market or research trend for 2-Methyl-4-(trifluoromethoxy)benzoic acid (CAS: 261951-91-1)?

The market for 2-Methyl-4-(trifluoromethoxy)benzoic acid (CAS: 261951-91-1) is driven by its applica...

Compound Q&A

How should waste containing 2-Methyl-4-(trifluoromethoxy)benzoic acid (CAS: 261951-91-1) be handled?

Waste containing 2-Methyl-4-(trifluoromethoxy)benzoic acid (CAS: 261951-91-1) should be collected in...

Compound Q&A

How should waste containing (6-Bromo-2-naphthyl)oxy](dimethyl)(2-methyl-2-propanyl)silane be handled?

Waste containing (6-Bromo-2-naphthyl)oxy](dimethyl)(2-methyl-2-propanyl)silane (...

100751-65-3[(6-Bromo-2-naphthyl...
Compound Q&A

How is 7-Fluoro-4-isoquinolinecarboxylic acid (CAS: 1841081-40-0) typically synthesized?

7-Fluoro-4-isoquinolinecarboxylic acid can be synthesized via a multi-step proce...

1841081-40-07-Fluoro-4-isoquinol...
Compound Q&A

What are the physical and chemical properties of 2,3,5,6-Tetrabromothieno[3,2-b]thiophene (CAS: 124638-53-5)?

2,3,5,6-Tetrabromothieno[3,2-b]thiophene is a crystalline compound with a high m...

124638-53-52,3,5,6-Tetrabromoth...
Compound Q&A

Is 1-[4-(Benzylamino)-7,8-dihydro-5H-pyrano[4,3-d]pyrimidin-2-yl]-2-methyl-1H-indole-4-carboxamide (CAS: 1542705-92-9) safe?

1-[4-(Benzylamino)-7,8-dihydro-5H-pyrano[4,3-d]pyrimidin-2-yl]-2-methyl-1H-indol...

1542705-92-91-[4-(Benzylamino)-7...