Compound Q&A

How is Magnesium diiodate (CAS: 7790-32-1) typically synthesized?

Answer

Magnesium diiodate
Magnesium diiodate (CAS: 7790-32-1) can be synthesized by reacting magnesium hydroxide with iodine or hydrogen iodide. The synthesis typically occurs in aqueous solution at room temperature. The process involves the formation of magnesium iodate, which then reacts with additional iodine to form the diiodate salt.

About

CAS No 7790-32-1
English Name Magnesium diiodate
Molecular Formula I2MgO6
Molecular Weight 374.11 g/mol
SMILES [O-]I(=O)=O.[O-]I(=O)=O.[Mg+2]
InChIKey UYNRPXVNKVAGAN-UHFFFAOYSA-L
Last Updated: 2026-03-20 10:59

Related Q&A

Compound Q&A

What are the physical and chemical properties of Magnesium diiodate (CAS: 7790-32-1)?

Magnesium diiodate (CAS: 7790-32-1) is a crystalline compound with a molecular weight of approximate...

Compound Q&A

What industries use Magnesium diiodate (CAS: 7790-32-1)?

Magnesium diiodate (CAS: 7790-32-1) is used in various industries, including pharmaceuticals for its...

Compound Q&A

What precautions should be taken when handling Magnesium diiodate (CAS: 7790-32-1)?

When handling Magnesium diiodate (CAS: 7790-32-1), it is important to use personal protective equipm...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...