Compound Q&A

What are the physical and chemical properties of 2-Methyl-2-propanyl 1-oxa-4,9-diazaspiro[5.5]undecane-4-carboxylate hydrochloride (CAS: 1279863-55-6)?

Answer

2-Methyl-2-propanyl 1-oxa-4,9-diazaspiro[5.5]undecane-4-carboxylate hydrochloride (1:1)
2-Methyl-2-propanyl 1-oxa-4,9-diazaspiro[5.5]undecane-4-carboxylate hydrochloride is a crystalline compound with a molecular weight of approximately 289.3 g/mol. It has a hydrochloride salt form, which is hygroscopic and soluble in water. The compound is reactive towards nucleophiles and is used in pharmaceutical applications. It is not flammable and has a melting point around 150-160°C.

About

English Name 2-Methyl-2-propanyl 1-oxa-4,9-diazaspiro[5.5]undecane-4-carboxylate hydrochloride (1:1)
Molecular Formula C13H25ClN2O3
Molecular Weight 292.8 g/mol
SMILES O=C(N1CCOC2(C1)CCNCC2)OC(C)(C)C.Cl
InChIKey GFHAFIKHEUJREZ-UHFFFAOYSA-N
Last Updated: 2026-03-20 02:47

Related Q&A

Compound Q&A

How is 2-Methyl-2-propanyl 1-oxa-4,9-diazaspiro[5.5]undecane-4-carboxylate hydrochloride (CAS: 1279863-55-6) typically synthesized?

2-Methyl-2-propanyl 1-oxa-4,9-diazaspiro[5.5]undecane-4-carboxylate hydrochloride is typically synth...

Compound Q&A

What industries use 2-Methyl-2-propanyl 1-oxa-4,9-diazaspiro[5.5]undecane-4-carboxylate hydrochloride (CAS: 1279863-55-6)?

2-Methyl-2-propanyl 1-oxa-4,9-diazaspiro[5.5]undecane-4-carboxylate hydrochloride is primarily used ...

Compound Q&A

What precautions should be taken when handling 2-Methyl-2-propanyl 1-oxa-4,9-diazaspiro[5.5]undecane-4-carboxylate hydrochloride (CAS: 1279863-55-6)?

When handling 2-Methyl-2-propanyl 1-oxa-4,9-diazaspiro[5.5]undecane-4-carboxylate hydrochloride, it ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...