Compound Q&A

What precautions should be taken when handling ({[1-(6-Amino-9H-purin-9-yl)-2-Propanyl]oxy}methyl)phosphonic acid (CAS: 107021-12-5)?

Answer

({[1-(6-Amino-9H-purin-9-yl)-2-propanyl]oxy}methyl)phosphonic acid
When handling ({[1-(6-Amino-9H-purin-9-yl)-2-Propanyl]oxy}methyl)phosphonic acid (CAS: 107021-12-5), it is essential to use appropriate personal protective equipment (PPE) including gloves, goggles, and a lab coat. Ensure the work is conducted in a well-ventilated area or a fume hood to minimize inhalation risks. Spills should be carefully cleaned up using appropriate absorbents, and the material safety data sheet (MSDS) should be consulted for specific disposal and emergency procedures.

About

English Name ({[1-(6-Amino-9H-purin-9-yl)-2-propanyl]oxy}methyl)phosphonic acid
Molecular Formula C9H14N5O4P
Molecular Weight 287.22 g/mol
SMILES CC(CN1C=NC2=C(N=CN=C21)N)OCP(=O)(O)O
InChIKey SGOIRFVFHAKUTI-UHFFFAOYSA-N
Last Updated: 2026-03-20 02:47

Related Q&A

Compound Q&A

What are the physical and chemical properties of ({[1-(6-Amino-9H-purin-9-yl)-2-propanyl]oxy}methyl)phosphonic acid (CAS: 107021-12-5)?

({[1-(6-Amino-9H-purin-9-yl)-2-Propanyl]oxy}methyl)phosphonic acid (CAS: 107021-12-5) is a crystalli...

Compound Q&A

How is ({[1-(6-Amino-9H-purin-9-yl)-2-Propanyl]oxy}methyl)phosphonic acid (CAS: 107021-12-5) typically synthesized?

({[1-(6-Amino-9H-purin-9-yl)-2-Propanyl]oxy}methyl)phosphonic acid (CAS: 107021-12-5) can be synthes...

Compound Q&A

What industries use ({[1-(6-Amino-9H-purin-9-yl)-2-Propanyl]oxy}methyl)phosphonic acid (CAS: 107021-12-5)?

({[1-(6-Amino-9H-purin-9-yl)-2-Propanyl]oxy}methyl)phosphonic acid (CAS: 107021-12-5) finds applicat...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...