Compound Q&A

What are the physical and chemical properties of 2-Methyl-2-propanyl 3-(chloromethyl)-1-piperidinecarboxylate (CAS: 876589-09-2)?

Answer

2-Methyl-2-propanyl 3-(chloromethyl)-1-piperidinecarboxylate
2-Methyl-2-propanyl 3-(chloromethyl)-1-piperidinecarboxylate is a crystalline solid with a molecular weight of approximately 242.8 g/mol. It has a low solubility in water but is soluble in common organic solvents like ethanol and acetone. This compound is moderately reactive, particularly towards nucleophiles. It is stable under normal conditions but should be stored in a cool, dry place away from strong acids and bases.

About

English Name 2-Methyl-2-propanyl 3-(chloromethyl)-1-piperidinecarboxylate
Molecular Formula C11H20ClNO2
Molecular Weight 233.74 g/mol
SMILES CC(C)(C)OC(=O)N1CCCC(C1)CCl
InChIKey NLZPZOOLPLVGHZ-UHFFFAOYSA-N
Last Updated: 2026-03-20 02:47

Related Q&A

Compound Q&A

How is 2-Methyl-2-propanyl 3-(chloromethyl)-1-piperidinecarboxylate (CAS: 876589-09-2) typically synthesized?

2-Methyl-2-propanyl 3-(chloromethyl)-1-piperidinecarboxylate is typically synthesized through a mult...

Compound Q&A

What industries use 2-Methyl-2-propanyl 3-(chloromethyl)-1-piperidinecarboxylate (CAS: 876589-09-2)?

2-Methyl-2-propanyl 3-(chloromethyl)-1-piperidinecarboxylate is used in the pharmaceutical industry ...

Compound Q&A

What precautions should be taken when handling 2-Methyl-2-propanyl 3-(chloromethyl)-1-piperidinecarboxylate (CAS: 876589-09-2)?

When handling 2-Methyl-2-propanyl 3-(chloromethyl)-1-piperidinecarboxylate, it is essential to use a...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...