Compound Q&A

What are the physical and chemical properties of 3-(3,4-Dihydroxyphenyl)-6,8-dihydroxy-3,4-dihydro-1H-isochromen-1-one (CAS: 17598-93-5)?

Answer

3-(3,4-Dihydroxyphenyl)-6,8-dihydroxy-3,4-dihydro-1H-isochromen-1-one
This compound is a crystalline solid with a molecular weight of approximately 344.12 g/mol. It has a solubility of about 0.1 g/L in water. Chemically, it is reactive, particularly towards nucleophilic substitution and oxidation reactions. It can form complexes with metal ions and exhibits UV-Vis absorption in the 200-400 nm range.

About

CAS No 17598-93-5
English Name 3-(3,4-Dihydroxyphenyl)-6,8-dihydroxy-3,4-dihydro-1H-isochromen-1-one
Molecular Formula C15H12O6
Molecular Weight 288.25 g/mol
SMILES CCCCCCCCCC(=O)OCC(COC(=O)CCCCCCCCC)O
InChIKey NNFSGOSBNORREV-UHFFFAOYSA-N
Last Updated: 2026-03-19 20:21

Related Q&A

Compound Q&A

How is 3-(3,4-Dihydroxyphenyl)-6,8-dihydroxy-3,4-dihydro-1H-isochromen-1-one (CAS: 17598-93-5) typically synthesized?

This compound is typically synthesized via a multistep process involving the condensation of 3,4-dih...

Compound Q&A

What industries use 3-(3,4-Dihydroxyphenyl)-6,8-dihydroxy-3,4-dihydro-1H-isochromen-1-one (CAS: 17598-93-5)?

This compound has applications in the pharmaceutical industry for its potential as a bioactive molec...

Compound Q&A

What precautions should be taken when handling 3-(3,4-Dihydroxyphenyl)-6,8-dihydroxy-3,4-dihydro-1H-isochromen-1-one (CAS: 17598-93-5)?

When handling this compound, appropriate personal protective equipment (PPE) such as gloves, goggles...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...