Compound Q&A

What industries use Fmoc-(2S,3R)-3-phenylpyrrolidine-2-carboxylic acid (CAS: 281655-32-1)?

Answer

Fmoc-(2S,3R)-3-phenylpyrrolidine-2-carboxylic acid
Fmoc-(2S,3R)-3-phenylpyrrolidine-2-carboxylic acid is primarily used in the pharmaceutical industry for solid-phase peptide synthesis. It is also employed in polymer chemistry for the preparation of functional polymers and in the development of chemical sensors and semiconductors due to its unique functional groups.

About

English Name Fmoc-(2S,3R)-3-phenylpyrrolidine-2-carboxylic acid
Molecular Formula C26H23NO4
Molecular Weight 413.4730000000001 g/mol
SMILES C1CN(C(C1C2=CC=CC=C2)C(=O)O)C(=O)OCC3C4=CC=CC=C4C5=CC=CC=C35
InChIKey XZINBBVSLWSWBO-KOSHJBKYSA-N
Last Updated: 2026-03-19 20:21

Related Q&A

Compound Q&A

What are the physical and chemical properties of Fmoc-(2S,3R)-3-phenylpyrrolidine-2-carboxylic acid (CAS: 281655-32-1)?

Fmoc-(2S,3R)-3-phenylpyrrolidine-2-carboxylic acid is a white crystalline solid with a molecular wei...

Compound Q&A

How is Fmoc-(2S,3R)-3-phenylpyrrolidine-2-carboxylic acid (CAS: 281655-32-1) typically synthesized?

Fmoc-(2S,3R)-3-phenylpyrrolidine-2-carboxylic acid is synthesized through a multi-step process that ...

Compound Q&A

What precautions should be taken when handling Fmoc-(2S,3R)-3-phenylpyrrolidine-2-carboxylic acid (CAS: 281655-32-1)?

When handling Fmoc-(2S,3R)-3-phenylpyrrolidine-2-carboxylic acid, it is essential to use appropriate...

155412-88-71-(3-Aminophenyl)-3-...
Compound Q&A

How should waste containing 1-(D-Ribofuranosyl)-1,4-dihydro-3-pyridinecarboxamide (CAS: 19132-12-8) be handled?

Waste containing 1-(D-Ribofuranosyl)-1,4-dihydro-3-pyridinecarboxamide (CAS: 191...

19132-12-81-(D-Ribofuranosyl)-...
Compound Q&A

What regulatory guidelines apply to 2-Methyl-2-propanyl 3-bromo-3-(hydroxymethyl)-1-azetidinecarboxylate (CAS: 2007919-81-3)?

2-Methyl-2-propanyl 3-bromo-3-(hydroxymethyl)-1-azetidinecarboxylate (CAS: 20079...

2007919-81-32-Methyl-2-propanyl ...
Compound Q&A

What is N-(4-Chloro-2-pyridinyl)acetamide (CAS: 245056-66-0)?

N-(4-Chloro-2-pyridinyl)acetamide (CAS: 245056-66-0) is a chemical compound with...

245056-66-0N-(4-Chloro-2-pyridi...