Compound Q&A

How is Fmoc-(2S,3R)-3-phenylpyrrolidine-2-carboxylic acid (CAS: 281655-32-1) typically synthesized?

Answer

Fmoc-(2S,3R)-3-phenylpyrrolidine-2-carboxylic acid
Fmoc-(2S,3R)-3-phenylpyrrolidine-2-carboxylic acid is synthesized through a multi-step process that involves the condensation of 3-phenylpyrrolidine-2-carboxylic acid with Fmoc-Cl. The reaction is typically catalyzed by diisopropylcarbodiimide (DIC) and 1-hydroxybenzotriazole (HOBt) to enhance the coupling efficiency. The final product is then purified by column chromatography using a suitable solvent system.

About

English Name Fmoc-(2S,3R)-3-phenylpyrrolidine-2-carboxylic acid
Molecular Formula C26H23NO4
Molecular Weight 413.4730000000001 g/mol
SMILES C1CN(C(C1C2=CC=CC=C2)C(=O)O)C(=O)OCC3C4=CC=CC=C4C5=CC=CC=C35
InChIKey XZINBBVSLWSWBO-KOSHJBKYSA-N
Last Updated: 2026-03-19 20:21

Related Q&A

Compound Q&A

What are the physical and chemical properties of Fmoc-(2S,3R)-3-phenylpyrrolidine-2-carboxylic acid (CAS: 281655-32-1)?

Fmoc-(2S,3R)-3-phenylpyrrolidine-2-carboxylic acid is a white crystalline solid with a molecular wei...

Compound Q&A

What industries use Fmoc-(2S,3R)-3-phenylpyrrolidine-2-carboxylic acid (CAS: 281655-32-1)?

Fmoc-(2S,3R)-3-phenylpyrrolidine-2-carboxylic acid is primarily used in the pharmaceutical industry ...

Compound Q&A

What precautions should be taken when handling Fmoc-(2S,3R)-3-phenylpyrrolidine-2-carboxylic acid (CAS: 281655-32-1)?

When handling Fmoc-(2S,3R)-3-phenylpyrrolidine-2-carboxylic acid, it is essential to use appropriate...

155412-88-71-(3-Aminophenyl)-3-...
Compound Q&A

How should waste containing 1-(D-Ribofuranosyl)-1,4-dihydro-3-pyridinecarboxamide (CAS: 19132-12-8) be handled?

Waste containing 1-(D-Ribofuranosyl)-1,4-dihydro-3-pyridinecarboxamide (CAS: 191...

19132-12-81-(D-Ribofuranosyl)-...
Compound Q&A

What regulatory guidelines apply to 2-Methyl-2-propanyl 3-bromo-3-(hydroxymethyl)-1-azetidinecarboxylate (CAS: 2007919-81-3)?

2-Methyl-2-propanyl 3-bromo-3-(hydroxymethyl)-1-azetidinecarboxylate (CAS: 20079...

2007919-81-32-Methyl-2-propanyl ...
Compound Q&A

What is N-(4-Chloro-2-pyridinyl)acetamide (CAS: 245056-66-0)?

N-(4-Chloro-2-pyridinyl)acetamide (CAS: 245056-66-0) is a chemical compound with...

245056-66-0N-(4-Chloro-2-pyridi...