Compound Q&A

How is Ethyl (2-chlorophenyl)(6,7-dihydrothieno[3,2-c]pyridin-5(4H)-yl)acetate sulfate (1:1) (CAS: 1357474-92-0) typically synthesized?

Answer

Ethyl (2-chlorophenyl)(6,7-dihydrothieno[3,2-c]pyridin-5(4H)-yl)acetate sulfate (1:1)
Ethyl (2-chlorophenyl)(6,7-dihydrothieno[3,2-c]pyridin-5(4H)-yl)acetate sulfate (1:1) is synthesized through a multi-step process involving the coupling of a chlorophenyl moiety with a thienopyridine derivative. The reaction typically requires a base and a catalyst, such as a phase-transfer catalyst, to increase the yield and selectivity. The product is then derivatized with an acetic acid derivative and finally converted to the sulfate salt.

About

English Name Ethyl (2-chlorophenyl)(6,7-dihydrothieno[3,2-c]pyridin-5(4H)-yl)acetate sulfate (1:1)
Molecular Formula C17H20ClNO6S2
Molecular Weight 433.94 g/mol
SMILES CCOC(=O)C(c1ccccc1Cl)N2CCc3c(ccs3)C2.OS(=O)(=O)O
InChIKey CZPQIIDIBKISIG-UHFFFAOYSA-N
Last Updated: 2026-03-19 20:21

Related Q&A

Compound Q&A

What are the physical and chemical properties of Ethyl (2-chlorophenyl)(6,7-dihydrothieno[3,2-c]pyridin-5(4H)-yl)acetate sulfate (1:1) (CAS: 1357474-92-0)?

Ethyl (2-chlorophenyl)(6,7-dihydrothieno[3,2-c]pyridin-5(4H)-yl)acetate sulfate (1:1) is a crystalli...

Compound Q&A

What industries use Ethyl (2-chlorophenyl)(6,7-dihydrothieno[3,2-c]pyridin-5(4H)-yl)acetate sulfate (1:1) (CAS: 1357474-92-0)?

Ethyl (2-chlorophenyl)(6,7-dihydrothieno[3,2-c]pyridin-5(4H)-yl)acetate sulfate (1:1) is used in the...

Compound Q&A

What precautions should be taken when handling Ethyl (2-chlorophenyl)(6,7-dihydrothieno[3,2-c]pyridin-5(4H)-yl)acetate sulfate (1:1) (CAS: 1357474-92-0)?

Handling Ethyl (2-chlorophenyl)(6,7-dihydrothieno[3,2-c]pyridin-5(4H)-yl)acetate sulfate (1:1) requi...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...