Compound Q&A

What industries use Resorcine blue (CAS: 87495-30-5)?

Answer

Resorcine blue
Resorcine blue (CAS: 87495-30-5) is predominantly used in the pharmaceutical, textile, and analytical chemistry industries. It serves as a pH indicator, dyeing agent, and can be employed in the development of sensors and colloidal systems. Its ability to change color in response to changes in pH makes it valuable in research and quality control applications.

About

CAS No 87495-30-5
English Name Resorcine blue
Molecular Formula C12H6Br4N2O3
Molecular Weight 545.8 g/mol
SMILES C1=C2C(=C(C(=C1Br)[O-])Br)OC3=C(C(=O)C(=CC3=N2)Br)Br.[NH4+]
InChIKey FSPQQBZXXZWDPJ-UHFFFAOYSA-N
Last Updated: 2026-03-19 14:17

Related Q&A

Compound Q&A

What are the physical and chemical properties of Resorcine blue (CAS: 87495-30-5)?

Resorcine blue (CAS: 87495-30-5) is a highly colored, water-soluble anionic dye. It has a molecular ...

Compound Q&A

How is Resorcine blue (CAS: 87495-30-5) typically synthesized?

Resorcine blue (CAS: 87495-30-5) is typically synthesized by the coupling of resorcinol with a diazo...

Compound Q&A

What precautions should be taken when handling Resorcine blue (CAS: 87495-30-5)?

When handling Resorcine blue (CAS: 87495-30-5), it is important to wear appropriate personal protect...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...