Compound Q&A

What industries use (3alpha,5beta,8alpha,9beta,10alpha,13alpha)-9,17-Dihydroxy-3-{[(2E)-3-phenyl-2-propenoyl]oxy}kaur-15-en-18-oic acid (CAS: 2186648-60-0)?

Answer

(3alpha,5beta,8alpha,9beta,10alpha,13alpha)-9,17-Dihydroxy-3-{[(2E)-3-phenyl-2-propenoyl]oxy}kaur-15-en-18-oic acid
This compound is primarily used in the pharmaceutical industry for its potential biological activities, such as anti-inflammatory and antioxidant properties. It may also have applications in the polymer industry for the development of novel materials, and in the sensor industry for its sensitivity to certain environmental conditions. Specific applications in semiconductors and electronic devices are less common but may be explored for specialized uses.

About

English Name (3alpha,5beta,8alpha,9beta,10alpha,13alpha)-9,17-Dihydroxy-3-{[(2E)-3-phenyl-2-propenoyl]oxy}kaur-15-en-18-oic acid
Molecular Formula C29H36O6
Molecular Weight 480.59 g/mol
SMILES C[C@]1([C@@H](CC[C@]2(C)[C@@H]1CC[C@@]13C[C@@H](CC[C@@]21O)C(CO)=C3)OC(=O)/C=C/C1=CC=CC=C1)C(O)=O
InChIKey AODVUYDMZFOGDV-OKOIVJNTSA-N
Last Updated: 2026-03-19 14:17

Related Q&A

Compound Q&A

How is (3alpha,5beta,8alpha,9beta,10alpha,13alpha)-9,17-Dihydroxy-3-{[(2E)-3-phenyl-2-propenoyl]oxy}kaur-15-en-18-oic acid (CAS: 2186648-60-0) typically synthesized?

This compound can be synthesized through a series of reactions involving kaurane derivatives, often ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...