Compound Q&A

How should N,N,N-Trimethylmethanaminium bis[(trifluoromethyl)sulfonyl]azanide (CAS: 161401-25-8) be stored?

Answer

N,N,N-Trimethylmethanaminium bis[(trifluoromethyl)sulfonyl]azanide
N,N,N-Trimethylmethanaminium bis[(trifluoromethyl)sulfonyl]azanide should be stored in a cool, dry place away from direct sunlight and heat sources. It should be kept in a tightly sealed container to maintain its stability. Avoid storing it near incompatible materials such as acids or reducing agents. Maintain a temperature range of 15-25°C and humidity below 50% to prevent degradation.

About

English Name N,N,N-Trimethylmethanaminium bis[(trifluoromethyl)sulfonyl]azanide
Molecular Formula C6H12F6N2O4S2
Molecular Weight 354.290900230408 g/mol
SMILES C[N+](C)(C)C.C(F)(F)(F)S(=O)(=O)[N-]S(=O)(=O)C(F)(F)F
InChIKey JTCSZQBQVDPVMT-UHFFFAOYSA-N
Last Updated: 2026-03-19 09:26

Related Q&A

Compound Q&A

What is N,N,N-Trimethylmethanaminium bis[(trifluoromethyl)sulfonyl]azanide (CAS: 161401-25-8)?

N,N,N-Trimethylmethanaminium bis[(trifluoromethyl)sulfonyl]azanide is a chemical compound with the C...

Compound Q&A

What are the main uses of N,N,N-Trimethylmethanaminium bis[(trifluoromethyl)sulfonyl]azanide (CAS: 161401-25-8)?

N,N,N-Trimethylmethanaminium bis[(trifluoromethyl)sulfonyl]azanide is primarily used as a reagent in...

Compound Q&A

Is N,N,N-Trimethylmethanaminium bis[(trifluoromethyl)sulfonyl]azanide (CAS: 161401-25-8) safe?

N,N,N-Trimethylmethanaminium bis[(trifluoromethyl)sulfonyl]azanide is generally considered safe when...

Compound Q&A

Is 2-Nitro-3,5,6-trimethylphenol (CAS: 94045-97-3) safe?

2-Nitro-3,5,6-trimethylphenol (CAS: 94045-97-3) is generally considered safe whe...

94045-97-32-Nitro-3,5,6-trimet...
Compound Q&A

What is 4-Aminophenyl 4-O-beta-D-galactopyranosyl-beta-D-glucopyranoside (CAS: 17691-02-0)?

4-Aminophenyl 4-O-beta-D-galactopyranosyl-beta-D-glucopyranoside is a complex or...

17691-02-04-Aminophenyl 4-O-be...
Compound Q&A

What precautions should be taken when handling 3-bromo-N,N-dimethylpyridin-2-amine (CAS: 1060801-39-9)?

When handling 3-bromo-N,N-dimethylpyridin-2-amine (CAS: 1060801-39-9), it is imp...

1060801-39-93-bromo-N,N-dimethyl...
Compound Q&A

How should waste containing 5-Bromo-N~4~-ethyl-3,4-pyridinediamine (CAS: 607371-03-9) be handled?

Waste containing 5-Bromo-N~4~-ethyl-3,4-pyridinediamine (CAS: 607371-03-9) shoul...

607371-03-95-Bromo-N~4~-ethyl-3...