Compound Q&A

What are the main uses of 2-[(2-Hydroxyethyl)amino]-4,6-dinitrophenol (CAS: 99610-72-7)?

Answer

2-[(2-Hydroxyethyl)amino]-4,6-dinitrophenol
2-[(2-Hydroxyethyl)amino]-4,6-dinitrophenol is primarily used as a research reagent and in the synthesis of other compounds. It plays a role in the development of pharmaceuticals and as an intermediate in various chemical processes. It is also used in some experimental settings due to its chemical properties.

About

CAS No 99610-72-7
English Name 2-[(2-Hydroxyethyl)amino]-4,6-dinitrophenol
Molecular Formula C8H9N3O6
Molecular Weight 243.17 g/mol
SMILES c1c(cc(c(c1NCCO)O)[N+](=O)[O-])[N+](=O)[O-]
InChIKey OABRBVCUJIJMOB-UHFFFAOYSA-N
Last Updated: 2026-03-19 01:47

Related Q&A

Compound Q&A

What is 2-[(2-Hydroxyethyl)amino]-4,6-dinitrophenol (CAS: 99610-72-7)?

2-[(2-Hydroxyethyl)amino]-4,6-dinitrophenol is a chemical compound with the CAS number 99610-72-7. I...

Compound Q&A

Is 2-[(2-Hydroxyethyl)amino]-4,6-dinitrophenol (CAS: 99610-72-7) safe?

2-[(2-Hydroxyethyl)amino]-4,6-dinitrophenol (CAS: 99610-72-7) is not considered safe for general use...

Compound Q&A

How should 2-[(2-Hydroxyethyl)amino]-4,6-dinitrophenol (CAS: 99610-72-7) be stored?

2-[(2-Hydroxyethyl)amino]-4,6-dinitrophenol should be stored in a cool, well-ventilated area away fr...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...